m-Benzenedisulfonyl chloride
m-Benzenedisulfonyl chloride structure
|
Common Name | m-Benzenedisulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 6461-76-3 | Molecular Weight | 275.130 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 394.4±25.0 °C at 760 mmHg | |
| Molecular Formula | C6H4Cl2O4S2 | Melting Point | 140-146 °C | |
| MSDS | N/A | Flash Point | 192.3±23.2 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,2-benzenedisulfonyl dichloride |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 394.4±25.0 °C at 760 mmHg |
| Melting Point | 140-146 °C |
| Molecular Formula | C6H4Cl2O4S2 |
| Molecular Weight | 275.130 |
| Flash Point | 192.3±23.2 °C |
| Exact Mass | 273.892792 |
| PSA | 85.04000 |
| LogP | 3.26 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.579 |
| InChIKey | YBGQXNZTVFEKEN-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)c1ccccc1S(=O)(=O)Cl |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | C |
|---|---|
| Risk Phrases | R34 |
| Safety Phrases | S26-S36/37/39-S45 |
| RIDADR | UN 3261 8/PG 3 |
| WGK Germany | 3 |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 2904909090 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,2-BENZENEDISULFONYL DICHLORIDE |
| m-Benzenedisulfonyl dichloride |
| o-benzendisulfonyl dichloride |
| m-Benzenedisulfonyl chloride |
| o-Benzenedisulfonyl chloride |
| benzene-1,2-disulphonyl dichloride |
| o-Benzenedisulfonylchlorid |
| 1,2-benzenedisulfonyl chloride |
| Benzene-1,2-disulfochloride |
| Benzene-1,2-disulfonyl dichloride |
| benzene-1,2-disulfonyl chloride |
| MFCD00059836 |
| 1,2-benzenedisulfonylchloride |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 1,2-benzenedisulfonyl dichloride? |
| A: CAS number of 1,2-benzenedisulfonyl dichloride is 6461-76-3. |
| Q: What is the molecular weight of 1,2-benzenedisulfonyl dichloride? |
| A: Molecular weight of 1,2-benzenedisulfonyl dichloride is 275.130. |
| Q: What English synonyms does 1,2-benzenedisulfonyl dichloride have? |
| A: English synonyms of 1,2-benzenedisulfonyl dichloride: 1,2-BENZENEDISULFONYL DICHLORIDE, m-Benzenedisulfonyl dichloride, o-benzendisulfonyl dichloride, m-Benzenedisulfonyl chloride, o-Benzenedisulfonyl chloride, benzene-1,2-disulphonyl dichloride, o-Benzenedisulfonylchlorid, 1,2-benzenedisulfonyl chloride, Benzene-1,2-disulfochloride, Benzene-1,2-disulfonyl dichloride, benzene-1,2-disulfonyl chloride, MFCD00059836, 1,2-benzenedisulfonylchloride. |
| Q: What is the English name of 1,2-benzenedisulfonyl dichloride? |
| A: The English name of 1,2-benzenedisulfonyl dichloride is 1,2-benzenedisulfonyl dichloride. |
| Q: What is the melting point of 1,2-benzenedisulfonyl dichloride? |
| A: Melting point of 1,2-benzenedisulfonyl dichloride is 140-146 °C. |
| Q: What is the LogP of 1,2-benzenedisulfonyl dichloride? |
| A: LogP of 1,2-benzenedisulfonyl dichloride is 3.26. |
| Q: What is the InChIKey of 1,2-benzenedisulfonyl dichloride? |
| A: InChIKey of 1,2-benzenedisulfonyl dichloride is YBGQXNZTVFEKEN-UHFFFAOYSA-N. |
| Q: What is the boiling point of 1,2-benzenedisulfonyl dichloride? |
| A: Boiling point of 1,2-benzenedisulfonyl dichloride is 394.4±25.0 °C at 760 mmHg. |
| Q: What is the SMILES notation of 1,2-benzenedisulfonyl dichloride? |
| A: SMILES notation of 1,2-benzenedisulfonyl dichloride is O=S(=O)(Cl)c1ccccc1S(=O)(=O)Cl. |
| Q: What is the polar surface area (PSA) of 1,2-benzenedisulfonyl dichloride? |
| A: Polar surface area (PSA) of 1,2-benzenedisulfonyl dichloride is 85.04000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |