1-methyl-3-octylimidazolium chloride structure
|
Common Name | 1-methyl-3-octylimidazolium chloride | ||
|---|---|---|---|---|
| CAS Number | 64697-40-1 | Molecular Weight | 230.777 | |
| Density | 1.01 g/mL at 20ºC(lit.) | Boiling Point | N/A | |
| Molecular Formula | C12H23ClN2 | Melting Point | 12°C(lit.) | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-methyl-1-octylimidazolium chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.01 g/mL at 20ºC(lit.) |
|---|---|
| Melting Point | 12°C(lit.) |
| Molecular Formula | C12H23ClN2 |
| Molecular Weight | 230.777 |
| Exact Mass | 230.154984 |
| PSA | 8.81000 |
| Index of Refraction | n20/D 1.51 |
| InChIKey | OXFBEEDAZHXDHB-UHFFFAOYSA-M |
| SMILES | CCCCCCCCn1cc[n+](C)c1.[Cl-] |
| Storage condition | 2-8℃ |
| Water Solubility | Slightly soluble in water. |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| WGK Germany | 3 |
| HS Code | 2933290090 |
|
~96%
1-methyl-3-octy... CAS#:64697-40-1 |
| Literature: Tetrahedron, , vol. 66, # 6 p. 1352 - 1356 |
|
~%
1-methyl-3-octy... CAS#:64697-40-1 |
| Literature: New Journal of Chemistry, , vol. 37, # 4 p. 873 - 876 |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-octyl-3-methylimidazolium chloride |
| 3-methyl-1-octylimidazolium chloride |
| 1-methyl-3-octylimidazol-1-ium,chloride |
| 1-methyl-3-octylimidazolium chloride |
| 1H-Imidazolium, 3-methyl-1-octyl-, chloride (1:1) |
| 3-Methyl-1-octyl-1H-imidazol-3-ium chloride |
| MFCD03095432 |