2-Anthracenecarbonylchloride, 1-amino-9,10-dihydro-9,10-dioxo- structure
|
Common Name | 2-Anthracenecarbonylchloride, 1-amino-9,10-dihydro-9,10-dioxo- | ||
|---|---|---|---|---|
| CAS Number | 6470-88-8 | Molecular Weight | 285.68200 | |
| Density | 1.521g/cm3 | Boiling Point | 536ºC at 760 mmHg | |
| Molecular Formula | C15H8ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 278ºC | |
| Name | 1-amino-9,10-dioxoanthracene-2-carbonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.521g/cm3 |
|---|---|
| Boiling Point | 536ºC at 760 mmHg |
| Molecular Formula | C15H8ClNO3 |
| Molecular Weight | 285.68200 |
| Flash Point | 278ºC |
| Exact Mass | 285.01900 |
| PSA | 77.23000 |
| LogP | 3.00440 |
| Index of Refraction | 1.707 |
| InChIKey | BIZVHVKTTCPVPP-UHFFFAOYSA-N |
| SMILES | Nc1c(C(=O)Cl)ccc2c1C(=O)c1ccccc1C2=O |
| HS Code | 2922399090 |
|---|
|
~%
2-Anthracenecar... CAS#:6470-88-8 |
| Literature: BASF Patent: DE403395 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 14, p. 870 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1-amino-2-anthraquinonecarbonyl chloride |
| 1-aminoanthraquinone-2-carboxylic acid chloride |
| 1-amino-9,10-dioxo-9,10-dihydro-anthracene-2-carbonyl chloride |
| 1-Amino-anthrachinon-carbonsaeure-(2)-chlorid |
| 1-Amino-9,10-dioxo-9,10-dihydro-anthracen-2-carbonylchlorid |
| 1-Aminoanthraquinone-2-carbonyl chloride |
| 2-Anthroyl chloride,10-dihydro-9,10-dioxo |