1-Amino-9,10-dioxo-9,10-dihydro-2-anthracenecarboxylic acid structure
|
Common Name | 1-Amino-9,10-dioxo-9,10-dihydro-2-anthracenecarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 82-24-6 | Molecular Weight | 267.23600 | |
| Density | N/A | Boiling Point | 575.9ºC at 760 mmHg | |
| Molecular Formula | C15H9NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 302.1ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-amino-9,10-dioxoanthracene-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Boiling Point | 575.9ºC at 760 mmHg |
|---|---|
| Molecular Formula | C15H9NO4 |
| Molecular Weight | 267.23600 |
| Flash Point | 302.1ºC |
| Exact Mass | 267.05300 |
| PSA | 97.46000 |
| LogP | 2.32360 |
| InChIKey | MMKNBFSDCOALQO-UHFFFAOYSA-N |
| SMILES | Nc1c(C(=O)O)ccc2c1C(=O)c1ccccc1C2=O |
This table summarizes toxicological test data, acute & chronic toxicity and ecological hazard parameters for this chemical.
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATAMUTATION DATA
|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 6 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-Amino-2-carboxyanthraquinone |
| 1-amino-9,10-dioxo-9,10-dihydro-anthracene-2-carboxylic acid |
| 1-Amino-9,10-dihydro-9,10-dioxoanthracene-2-carboxylic acid |
| EINECS 201-406-2 |
| 1-Aminoanthraquinone-2-carboxylic acid |
| 1-amino-2-anthraquinonecarboxylic acid |
| 1-Amino-9,10-dioxo-9,10-dihydro-anthracen-2-carbonsaeure |
| 2-Anthraquinonecarboxylic acid,1-amino |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 1-amino-9,10-dioxoanthracene-2-carboxylic acid? |
| A: LogP of 1-amino-9,10-dioxoanthracene-2-carboxylic acid is 2.32360. |
| Q: What is the InChIKey of 1-amino-9,10-dioxoanthracene-2-carboxylic acid? |
| A: InChIKey of 1-amino-9,10-dioxoanthracene-2-carboxylic acid is MMKNBFSDCOALQO-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1-amino-9,10-dioxoanthracene-2-carboxylic acid? |
| A: Molecular formula of 1-amino-9,10-dioxoanthracene-2-carboxylic acid is C15H9NO4. |
| Q: What is the SMILES notation of 1-amino-9,10-dioxoanthracene-2-carboxylic acid? |
| A: SMILES notation of 1-amino-9,10-dioxoanthracene-2-carboxylic acid is Nc1c(C(=O)O)ccc2c1C(=O)c1ccccc1C2=O. |
| Q: What is the English name of 1-amino-9,10-dioxoanthracene-2-carboxylic acid? |
| A: The English name of 1-amino-9,10-dioxoanthracene-2-carboxylic acid is 1-amino-9,10-dioxoanthracene-2-carboxylic acid. |
| Q: What is the molecular weight of 1-amino-9,10-dioxoanthracene-2-carboxylic acid? |
| A: Molecular weight of 1-amino-9,10-dioxoanthracene-2-carboxylic acid is 267.23600. |
| Q: What are the upstream materials of 1-amino-9,10-dioxoanthracene-2-carboxylic acid? |
| A: Related upstream materials(CAS) of 1-amino-9,10-dioxoanthracene-2-carboxylic acid: 128-67-6;129-15-7;82-23-5;74214-86-1;873388-39-7;36764-97-3;3300-23-0;117-07-7;13432-32-1;84-54-8. |
| Q: What is the boiling point of 1-amino-9,10-dioxoanthracene-2-carboxylic acid? |
| A: Boiling point of 1-amino-9,10-dioxoanthracene-2-carboxylic acid is 575.9ºC at 760 mmHg. |
| Q: What is the polar surface area (PSA) of 1-amino-9,10-dioxoanthracene-2-carboxylic acid? |
| A: Polar surface area (PSA) of 1-amino-9,10-dioxoanthracene-2-carboxylic acid is 97.46000. |
| Q: What are the downstream products of 1-amino-9,10-dioxoanthracene-2-carboxylic acid? |
| A: Related downstream products(CAS) of 1-amino-9,10-dioxoanthracene-2-carboxylic acid: 82-45-1;6363-90-2;7400-93-3;65359-16-2;82-23-5;6470-88-8. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |