Benzamide,4-nitro-N-(5-nitro-2-thiazolyl)
Benzamide,4-nitro-N-(5-nitro-2-thiazolyl) structure
|
Common Name | Benzamide,4-nitro-N-(5-nitro-2-thiazolyl) | ||
|---|---|---|---|---|
| CAS Number | 64724-89-6 | Molecular Weight | 294.24300 | |
| Density | 1.684g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H6N4O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-nitro-N-(5-nitro-1,3-thiazol-2-yl)benzamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.684g/cm3 |
|---|---|
| Molecular Formula | C10H6N4O5S |
| Molecular Weight | 294.24300 |
| Exact Mass | 294.00600 |
| PSA | 161.87000 |
| LogP | 3.33120 |
| Index of Refraction | 1.739 |
| InChIKey | OPQDQCADZVFTGD-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ncc([N+](=O)[O-])s1)c1ccc([N+](=O)[O-])cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~85%
Benzamide,4-nit... CAS#:64724-89-6 |
| Literature: Ballard, T. Eric; Wang, Xia; Olekhnovich, Igor; Koerner, Taylor; Seymour, Craig; Salamoun, Joseph; Warthan, Michelle; Hoffman, Paul S.; Macdonald, Timothy L. ChemMedChem, 2011 , vol. 6, # 2 p. 362 - 377 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 4-nitro-N-(5-nitro-1,3-thiazol-2-yl)benzamide? |
| A: Polar surface area (PSA) of 4-nitro-N-(5-nitro-1,3-thiazol-2-yl)benzamide is 161.87000. |
| Q: What is the SMILES notation of 4-nitro-N-(5-nitro-1,3-thiazol-2-yl)benzamide? |
| A: SMILES notation of 4-nitro-N-(5-nitro-1,3-thiazol-2-yl)benzamide is O=C(Nc1ncc([N+](=O)[O-])s1)c1ccc([N+](=O)[O-])cc1. |
| Q: What is the Chinese name of 64724-89-6? |
| A: Chinese name of 64724-89-6 is 64724-89-6. |
| Q: What is the LogP of 4-nitro-N-(5-nitro-1,3-thiazol-2-yl)benzamide? |
| A: LogP of 4-nitro-N-(5-nitro-1,3-thiazol-2-yl)benzamide is 3.33120. |
| Q: What is the English name of 4-nitro-N-(5-nitro-1,3-thiazol-2-yl)benzamide? |
| A: The English name of 4-nitro-N-(5-nitro-1,3-thiazol-2-yl)benzamide is 4-nitro-N-(5-nitro-1,3-thiazol-2-yl)benzamide. |
| Q: What is the InChIKey of 4-nitro-N-(5-nitro-1,3-thiazol-2-yl)benzamide? |
| A: InChIKey of 4-nitro-N-(5-nitro-1,3-thiazol-2-yl)benzamide is OPQDQCADZVFTGD-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 4-nitro-N-(5-nitro-1,3-thiazol-2-yl)benzamide? |
| A: Molecular weight of 4-nitro-N-(5-nitro-1,3-thiazol-2-yl)benzamide is 294.24300. |
| Q: What is the CAS number of 4-nitro-N-(5-nitro-1,3-thiazol-2-yl)benzamide? |
| A: CAS number of 4-nitro-N-(5-nitro-1,3-thiazol-2-yl)benzamide is 64724-89-6. |
| Q: What is the molecular formula of 4-nitro-N-(5-nitro-1,3-thiazol-2-yl)benzamide? |
| A: Molecular formula of 4-nitro-N-(5-nitro-1,3-thiazol-2-yl)benzamide is C10H6N4O5S. |
| Q: What are the upstream materials of 4-nitro-N-(5-nitro-1,3-thiazol-2-yl)benzamide? |
| A: Related upstream materials(CAS) of 4-nitro-N-(5-nitro-1,3-thiazol-2-yl)benzamide: 121-66-4;122-04-3. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |