Platinum,dichloro(8-quinolinamine-kN1,kN8)-, (SP-4-3)- (9CI) structure
|
Common Name | Platinum,dichloro(8-quinolinamine-kN1,kN8)-, (SP-4-3)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 64828-04-2 | Molecular Weight | 418.22100 | |
| Density | N/A | Boiling Point | 289.8ºC at 760mmHg | |
| Molecular Formula | C9H16Cl2N2Pt | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.5ºC | |
| Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-id-8-ylazanide,dichloroplatinum(2+) |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 289.8ºC at 760mmHg |
|---|---|
| Molecular Formula | C9H16Cl2N2Pt |
| Molecular Weight | 418.22100 |
| Flash Point | 171.5ºC |
| Exact Mass | 417.03400 |
| PSA | 15.27000 |
| LogP | 2.78090 |
| InChIKey | CYIWOHQWCMUCRP-UHFFFAOYSA-L |
| SMILES | Cl[Pt+2]Cl.[NH-]C1CCCC2CCC[N-]C12 |
|
~79%
Platinum,dichlo... CAS#:64828-04-2 |
| Literature: Ray, Monojit; Bhattacharya, Santanu; Banerjee, Pradyot Journal of the Indian Chemical Society, 1999 , vol. 76, # 3 p. 121 - 124 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (8-aminoquinoline)dichloroplatinum(II) |
| Pt(8-NH2Q)Cl2 |
| dichloro(8-aminoquinoline)platinum(II) |
| Platinum,N(8))-,(SP-4-3) |