(2-phenylquinazolin-4-yl)hydrazine structure
|
Common Name | (2-phenylquinazolin-4-yl)hydrazine | ||
|---|---|---|---|---|
| CAS Number | 6484-29-3 | Molecular Weight | 236.27200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2-phenylquinazolin-4-yl)hydrazine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H12N4 |
|---|---|
| Molecular Weight | 236.27200 |
| Exact Mass | 236.10600 |
| PSA | 63.83000 |
| LogP | 3.35570 |
| InChIKey | WBJUWGCULCOZSW-UHFFFAOYSA-N |
| SMILES | NNc1nc(-c2ccccc2)nc2ccccc12 |
|
Name: Antileishmanial activity against Leishmania infantum promastigotes
Source: ChEMBL
Target: Leishmania infantum
External Id: CHEMBL5330149
|
|
Name: Antitrypanosomal activity against of Trypanosoma cruzi epimastigotes
Source: ChEMBL
Target: Trypanosoma cruzi
External Id: CHEMBL5330150
|
|
Name: Antitrypanosomal activity against of Trypanosoma cruzi epimastigotes at 25 uM
Source: ChEMBL
Target: Trypanosoma cruzi
External Id: CHEMBL5330151
|
| 2-phenyl-4-quinazolinylhydrazine |
| 4-hydrazinyl-2-phenylquinazoline |
| 4-HYDRAZINO-2-PHENYLQUINAZOLINE |
| 4-Hydrazino-2-phenylchinazolin |