(2-phenylquinazolin-4-yl)hydrazine
(2-phenylquinazolin-4-yl)hydrazine structure
|
Common Name | (2-phenylquinazolin-4-yl)hydrazine | ||
|---|---|---|---|---|
| CAS Number | 6484-29-3 | Molecular Weight | 236.27200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2-phenylquinazolin-4-yl)hydrazine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H12N4 |
|---|---|
| Molecular Weight | 236.27200 |
| Exact Mass | 236.10600 |
| PSA | 63.83000 |
| LogP | 3.35570 |
| InChIKey | WBJUWGCULCOZSW-UHFFFAOYSA-N |
| SMILES | NNc1nc(-c2ccccc2)nc2ccccc12 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 4 | |
![2-Phenyl-1H-benzo[d]imidazole structure](https://image.chemsrc.com/caspic/350/716-79-0.png)
CAS#:716-79-0![5-phenyl-[1,2,4]triazolo[4,3-c]quinazoline structure](https://image.chemsrc.com/caspic/027/6506-59-8.png)
CAS#:6506-59-8![2,5-diphenyl-[1,2,4]triazolo[1,5-c]quinazoline structure](https://image.chemsrc.com/caspic/276/61330-43-6.png)
CAS#:61330-43-6
CAS#:55810-22-5This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Antileishmanial activity against Leishmania infantum promastigotes
Source: ChEMBL
Target: Leishmania infantum
External Id: CHEMBL5330149
|
|
Name: Antitrypanosomal activity against of Trypanosoma cruzi epimastigotes
Source: ChEMBL
Target: Trypanosoma cruzi
External Id: CHEMBL5330150
|
|
Name: Antitrypanosomal activity against of Trypanosoma cruzi epimastigotes at 25 uM
Source: ChEMBL
Target: Trypanosoma cruzi
External Id: CHEMBL5330151
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-phenyl-4-quinazolinylhydrazine |
| 4-hydrazinyl-2-phenylquinazoline |
| 4-HYDRAZINO-2-PHENYLQUINAZOLINE |
| 4-Hydrazino-2-phenylchinazolin |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of (2-phenylquinazolin-4-yl)hydrazine? |
| A: LogP of (2-phenylquinazolin-4-yl)hydrazine is 3.35570. |
| Q: What is the InChIKey of (2-phenylquinazolin-4-yl)hydrazine? |
| A: InChIKey of (2-phenylquinazolin-4-yl)hydrazine is WBJUWGCULCOZSW-UHFFFAOYSA-N. |
| Q: What is the molecular weight of (2-phenylquinazolin-4-yl)hydrazine? |
| A: Molecular weight of (2-phenylquinazolin-4-yl)hydrazine is 236.27200. |
| Q: What is the CAS number of (2-phenylquinazolin-4-yl)hydrazine? |
| A: CAS number of (2-phenylquinazolin-4-yl)hydrazine is 6484-29-3. |
| Q: What is the English name of (2-phenylquinazolin-4-yl)hydrazine? |
| A: The English name of (2-phenylquinazolin-4-yl)hydrazine is (2-phenylquinazolin-4-yl)hydrazine. |
| Q: What is the polar surface area (PSA) of (2-phenylquinazolin-4-yl)hydrazine? |
| A: Polar surface area (PSA) of (2-phenylquinazolin-4-yl)hydrazine is 63.83000. |
| Q: What are the downstream products of (2-phenylquinazolin-4-yl)hydrazine? |
| A: Related downstream products(CAS) of (2-phenylquinazolin-4-yl)hydrazine: 716-79-0;6506-59-8;61330-43-6;55810-22-5. |
| Q: What English synonyms does (2-phenylquinazolin-4-yl)hydrazine have? |
| A: English synonyms of (2-phenylquinazolin-4-yl)hydrazine: 2-phenyl-4-quinazolinylhydrazine, 4-hydrazinyl-2-phenylquinazoline, 4-HYDRAZINO-2-PHENYLQUINAZOLINE, 4-Hydrazino-2-phenylchinazolin. |
| Q: What is the molecular formula of (2-phenylquinazolin-4-yl)hydrazine? |
| A: Molecular formula of (2-phenylquinazolin-4-yl)hydrazine is C14H12N4. |
| Q: What is the Chinese name of 6484-29-3? |
| A: Chinese name of 6484-29-3 is 6484-29-3. |