2-Phenyl-1H-benzo[d]imidazole structure
|
Common Name | 2-Phenyl-1H-benzo[d]imidazole | ||
|---|---|---|---|---|
| CAS Number | 716-79-0 | Molecular Weight | 194.232 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 395.4±25.0 °C at 760 mmHg | |
| Molecular Formula | C13H10N2 | Melting Point | 293-296 °C(lit.) | |
| MSDS | N/A | Flash Point | 210.0±9.6 °C | |
| Name | 2-Phenylbenzimidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 395.4±25.0 °C at 760 mmHg |
| Melting Point | 293-296 °C(lit.) |
| Molecular Formula | C13H10N2 |
| Molecular Weight | 194.232 |
| Flash Point | 210.0±9.6 °C |
| Exact Mass | 194.084396 |
| PSA | 28.68000 |
| LogP | 3.25 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.689 |
| InChIKey | DWYHDSLIWMUSOO-UHFFFAOYSA-N |
| SMILES | c1ccc(-c2nc3ccccc3[nH]2)cc1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Hazard Codes | Xn:Harmful |
|---|---|
| Risk Phrases | R22;R37/38;R41 |
| Safety Phrases | S26-S39 |
| WGK Germany | 3 |
| RTECS | DE0360000 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
|
Name: Luminescence-based cell-based primary high throughput screening assay to identify ago...
Source: The Scripps Research Institute Molecular Screening Center
Target: mu-type opioid receptor isoform MOR-1 [Homo sapiens]
External Id: OPRM1-OPRD1_AG_LUMI_1536_1X%ACT PRUN
|
|
Name: Fluorescence-based cell-based primary high throughput screening assay to identify ago...
Source: The Scripps Research Institute Molecular Screening Center
Target: muscarinic acetylcholine receptor M1 [Homo sapiens]
External Id: CHRM1_AG_FLUO8_1536_1X%ACT PRUN
|
|
Name: Cytochrome P450 Family 1 Subfamily A Member 2 (CYP1A2) small molecule antagonists: lu...
Source: 824
External Id: CYP273
|
|
Name: HSF-1 induced GFP reporter and Doxycycline induced RFP reporter Measured in Cell-Base...
Source: Broad Institute
Target: Hsf1 protein
External Id: 2038-03_Inhibitor_Dose_CherryPick_Activity_Set4
|
|
Name: Fluorescence-based cell-based primary high throughput screening assay to identify pos...
Source: The Scripps Research Institute Molecular Screening Center
Target: muscarinic acetylcholine receptor M1 [Homo sapiens]
External Id: CHRM1_PAM_FLUO8_1536_1X%ACT PRUN
|
|
Name: Fluorescence polarization-based biochemical high throughput primary assay to identify...
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=Sialate O-acetylesterase; AltName: Full=H-Lse; AltName: Full=Sialic acid-specific 9-O-acetylesterase; Flags: Precursor [Homo sapiens]
External Id: SIAE_INH_FP_1536_1X%INH PRUN
|
|
Name: p53 small molecule agonists, cell-based qHTS assay: qHTS cell viability counter scree...
Source: 824
Target: N/A
External Id: P53600
|
|
Name: Induction of QR1 activity in mouse Hepa-1c1c7 cells assessed as induction ratio at 50...
Source: ChEMBL
Target: NAD(P)H dehydrogenase [quinone] 1
External Id: CHEMBL4186379
|
|
Name: p53 small molecule agonists, cell-based qHTS assay with rat liver microsomes: qHTS ce...
Source: 824
Target: N/A
External Id: P53MS958
|
|
Name: p53 small molecule agonists, cell-based qHTS assay with rat liver microsomes: Summary
Source: 824
External Id: P53MS482
|
| RARECHEM AQ NN 0069 |
| phenizidole |
| G 570 |
| 2PB |
| Phendidole |
| phenzidol |
| phenzidole |
| N,N'-Benzenyl-o-phenylenediamine |
| EINECS 211-939-2 |
| MFCD00005592 |
| 2-phenyl benzimidazole |
| 2-Phenylbenzimidazole |
| 2-Phenyl-1H-benzimidazole |
| gainex |
| 2-phenyl-1H-benzo[d]imidazole |