WAY-312008 structure
|
Common Name | WAY-312008 | ||
|---|---|---|---|---|
| CAS Number | 648426-81-7 | Molecular Weight | 372.37 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 683.2±55.0 °C at 760 mmHg | |
| Molecular Formula | C22H16N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 367.0±31.5 °C | |
Use of WAY-312008G-Quadruplex Ligands (for the treatment of cancer) |
| Name | WAY-312008 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 683.2±55.0 °C at 760 mmHg |
| Molecular Formula | C22H16N2O4 |
| Molecular Weight | 372.37 |
| Flash Point | 367.0±31.5 °C |
| Exact Mass | 372.110992 |
| LogP | 3.95 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
| Index of Refraction | 1.730 |
| InChIKey | NEKOUQJZRZXMRA-UHFFFAOYSA-N |
| SMILES | O=c1c2ccccc2c(=O)c2c1c(NCCO)cc1oc3ccccc3[nH]c12 |
| 7-[(2-Hydroxyethyl)amino]-8H-naphtho[2,3-a]phenoxazine-8,13(14H)-dione |
| 7-(2-Hydroxy-ethylamino)-14H-naphtho[2,3-a]phenoxazine-8,13-dione |
| 8H-Naphtho[2,3-a]phenoxazine-8,13(14H)-dione, 7-[(2-hydroxyethyl)amino]- |