2,2’-Bithieno[3,2-b]thiophene structure
|
Common Name | 2,2’-Bithieno[3,2-b]thiophene | ||
|---|---|---|---|---|
| CAS Number | 648430-73-3 | Molecular Weight | 278.43600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H6S4 | Melting Point | 232-238 °C | |
| MSDS | USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 5-thieno[3,2-b]thiophen-5-ylthieno[3,2-b]thiophene |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 232-238 °C |
|---|---|
| Molecular Formula | C12H6S4 |
| Molecular Weight | 278.43600 |
| Exact Mass | 277.93500 |
| PSA | 112.96000 |
| LogP | 5.90600 |
| InChIKey | ZDFFDKMGCBNSKY-UHFFFAOYSA-N |
| SMILES | c1cc2sc(-c3cc4sccc4s3)cc2s1 |
|
~35%
2,2’-Bithieno[3... CAS#:648430-73-3 |
| Literature: Ito, Hiroki; Yamamoto, Tatsuya; Yoshimoto, Noriyuki; Tsushima, Noboru; Muraoka, Hiroki; Ogawa, Satoshi Heteroatom Chemistry, 2013 , vol. 24, # 1 p. 25 - 35 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
|
High efficiency and stable dye-sensitized solar cells with an organic chromophore featuring a binary pi-conjugated spacer.
Chem. Commun. (Camb.) , 2198, (2009) We employed a binary spacer of orderly conjugated 3,4-ethyldioxythiophene and thienothiophene to construct a wide-spectral response organic chromophore for dye-sensitized solar cells, exhibiting a hig... |
| MFCD27665376 |