(3,4-dinitrophenyl) phenyl carbonate structure
|
Common Name | (3,4-dinitrophenyl) phenyl carbonate | ||
|---|---|---|---|---|
| CAS Number | 64897-41-2 | Molecular Weight | 304.21200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H8N2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (3,4-dinitrophenyl) phenyl carbonate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H8N2O7 |
|---|---|
| Molecular Weight | 304.21200 |
| Exact Mass | 304.03300 |
| PSA | 127.17000 |
| LogP | 4.12720 |
| InChIKey | FRSDWSXTVZQXAI-UHFFFAOYSA-N |
| SMILES | O=C(Oc1ccccc1)Oc1ccc([N+](=O)[O-])c([N+](=O)[O-])c1 |
|
~%
(3,4-dinitrophe... CAS#:64897-41-2 |
| Literature: Gresser,M.J.; Jencks,W.P. Journal of the American Chemical Society, 1977 , vol. 99, # 21 p. 6963 - 6970 |
| 3,4-dinitrophenyl phenyl carbonate |
| Carbonic acid,3,4-dinitrophenyl phenyl ester |
| 3,4-Dinitrophenyl-phenylcarbonat |