bis(1,1,3-trihydroperfluoropropyl) sulfite
Modify Date: 2026-07-02 11:28:29
bis(1,1,3-trihydroperfluoropropyl) sulfite structure
|
Common Name | bis(1,1,3-trihydroperfluoropropyl) sulfite | ||
|---|---|---|---|---|
| CAS Number | 649-76-3 | Molecular Weight | 310.16200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H6F8O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | bis(1,1,3-trihydroperfluoropropyl) sulfite |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H6F8O3S |
|---|---|
| Molecular Weight | 310.16200 |
| Exact Mass | 309.99100 |
| PSA | 54.74000 |
| LogP | 3.26480 |
| InChIKey | NBRBXBPASVPTCI-UHFFFAOYSA-N |
| SMILES | O=S(OCC(F)(F)C(F)F)OCC(F)(F)C(F)F |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| sulfurous acid bis-(2,2,3,3-tetrafluoro-propyl) ester |
| Bis-(1H,1H,3H-tetrafluor-propyl)-sulfit |
| BIS(2,2,3,3-TETRAFLUOROPROPYL) SULFITE |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of bis(1,1,3-trihydroperfluoropropyl) sulfite? |
| A: Polar surface area (PSA) of bis(1,1,3-trihydroperfluoropropyl) sulfite is 54.74000. |
| Q: What is the English name of bis(1,1,3-trihydroperfluoropropyl) sulfite? |
| A: The English name of bis(1,1,3-trihydroperfluoropropyl) sulfite is bis(1,1,3-trihydroperfluoropropyl) sulfite. |
| Q: What is the molecular weight of bis(1,1,3-trihydroperfluoropropyl) sulfite? |
| A: Molecular weight of bis(1,1,3-trihydroperfluoropropyl) sulfite is 310.16200. |
| Q: What is the InChIKey of bis(1,1,3-trihydroperfluoropropyl) sulfite? |
| A: InChIKey of bis(1,1,3-trihydroperfluoropropyl) sulfite is NBRBXBPASVPTCI-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 649-76-3? |
| A: Chinese name of 649-76-3 is 649-76-3. |
| Q: What is the SMILES notation of bis(1,1,3-trihydroperfluoropropyl) sulfite? |
| A: SMILES notation of bis(1,1,3-trihydroperfluoropropyl) sulfite is O=S(OCC(F)(F)C(F)F)OCC(F)(F)C(F)F. |
| Q: What is the CAS number of bis(1,1,3-trihydroperfluoropropyl) sulfite? |
| A: CAS number of bis(1,1,3-trihydroperfluoropropyl) sulfite is 649-76-3. |
| Q: What English synonyms does bis(1,1,3-trihydroperfluoropropyl) sulfite have? |
| A: English synonyms of bis(1,1,3-trihydroperfluoropropyl) sulfite: sulfurous acid bis-(2,2,3,3-tetrafluoro-propyl) ester, Bis-(1H,1H,3H-tetrafluor-propyl)-sulfit, BIS(2,2,3,3-TETRAFLUOROPROPYL) SULFITE. |
| Q: What is the LogP of bis(1,1,3-trihydroperfluoropropyl) sulfite? |
| A: LogP of bis(1,1,3-trihydroperfluoropropyl) sulfite is 3.26480. |
| Q: What is the molecular formula of bis(1,1,3-trihydroperfluoropropyl) sulfite? |
| A: Molecular formula of bis(1,1,3-trihydroperfluoropropyl) sulfite is C6H6F8O3S. |