2-phenoxyisoindole-1,3-dione structure
|
Common Name | 2-phenoxyisoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 64908-64-1 | Molecular Weight | 239.22600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H9NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-phenoxyisoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H9NO3 |
|---|---|
| Molecular Weight | 239.22600 |
| Exact Mass | 239.05800 |
| PSA | 46.61000 |
| LogP | 2.21450 |
| InChIKey | GAMAGVXFNJWXNG-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)N1Oc1ccccc1 |
| HS Code | 2925190090 |
|---|
|
~90%
2-phenoxyisoind... CAS#:64908-64-1 |
| Literature: The Scripps Research Institute Patent: US2006/178527 A1, 2006 ; Location in patent: Page/Page column 7; 8; sheet 6 ; |
|
~%
2-phenoxyisoind... CAS#:64908-64-1 |
| Literature: CONNEXIOS LIFE SCIENCES PVT. LTD.; RANGANATH RAO, Jagannath Madanahalli; ARUMUGAM, Nagarajan; ANSARI, Mohd Mudabbir; GUDLA, Chandrasekhar; PACHIYAPPAN, Shanmugam; RAMALINGAM, Manivannan; GEORGE, Jenson; ARUL, George Fernanda; BOMMEGOWDA, Y, Kenchegowda; ANGUPILLAI, Sathesh Kumar; KOTTAMALAI, Ramamoorthy; JIDUGU, Pradeep; RAO, D, Shivanageshwara Patent: WO2012/11125 A1, 2012 ; WO 2012/011125 A1 |
| Precursor 3 | |
|---|---|
| DownStream 10 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-phenoxy-1H-isoindole-1,3(2H)-dione |
| N-Phenoxyphthalimid |
| N-phenoxyphtalimide |
| 1H-Isoindole-1,3(2H)-dione,2-phenoxy |
| N-phenoxy-phthalimide |
| 2-Phenoxyisoindoline-1,3-dione |