Imidazo[2,1-b]benzothiazole-2-carboxylicacid structure
|
Common Name | Imidazo[2,1-b]benzothiazole-2-carboxylicacid | ||
|---|---|---|---|---|
| CAS Number | 64951-09-3 | Molecular Weight | 218.23200 | |
| Density | 1.64g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H6N2O2S | Melting Point | 266-268ºC | |
| MSDS | USA | Flash Point | N/A | |
| Name | imidazo[2,1-b][1,3]benzothiazole-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.64g/cm3 |
|---|---|
| Melting Point | 266-268ºC |
| Molecular Formula | C10H6N2O2S |
| Molecular Weight | 218.23200 |
| Exact Mass | 218.01500 |
| PSA | 82.84000 |
| LogP | 2.24720 |
| Index of Refraction | 1.815 |
| InChIKey | RPTIDKXUZBSTRL-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cn2c(n1)sc1ccccc12 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2934100090 |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| imidazo<2,1-b>benzothiazole-2-carboxylic acid |
| Imidazo-benzothiazol-2-carbonsaeure |
| imidazo[2,1-b]benzothiazole-6-carboxylic acid |
| benzo[d]imidazo[2,1-b]thiazole-2-carboxylic acid |
| Imidazo[2,1-b]benzothiazole-2-carboxylic acid hydrate |