[1,1'-Biphenyl]-4,4'-diamine,N4,N4'-bis(methylene)- structure
|
Common Name | [1,1'-Biphenyl]-4,4'-diamine,N4,N4'-bis(methylene)- | ||
|---|---|---|---|---|
| CAS Number | 64954-05-8 | Molecular Weight | 208.25800 | |
| Density | 0.99g/cm3 | Boiling Point | 383.2ºC at 760 mmHg | |
| Molecular Formula | C14H12N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.9ºC | |
| Name | N,N'-([1,1'-biphenyl]-4,4'-diyl)dimethanimine |
|---|
| Density | 0.99g/cm3 |
|---|---|
| Boiling Point | 383.2ºC at 760 mmHg |
| Molecular Formula | C14H12N2 |
| Molecular Weight | 208.25800 |
| Flash Point | 177.9ºC |
| Exact Mass | 208.10000 |
| PSA | 24.72000 |
| LogP | 4.01780 |
| Index of Refraction | 1.562 |
| InChIKey | IYLGKGIOONTZRD-UHFFFAOYSA-N |
| SMILES | C=Nc1ccc(-c2ccc(N=C)cc2)cc1 |
|
~%
[1,1'-Biphenyl]... CAS#:64954-05-8 |
| Literature: Chandra, Sulekh; Jain, Deepali; Ratnam, Bindiya Journal of the Indian Chemical Society, 2010 , vol. 87, # 11 p. 1379 - 1383 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |