Ethenesulfonamide,1-bromo-2-phenyl-, (Z)- (9CI) structure
|
Common Name | Ethenesulfonamide,1-bromo-2-phenyl-, (Z)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 64984-22-1 | Molecular Weight | 262.12400 | |
| Density | 1.729g/cm3 | Boiling Point | 401.8ºC at 760 mmHg | |
| Molecular Formula | C8H8BrNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.8ºC | |
| Name | 1-bromo-2-phenylethenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.729g/cm3 |
|---|---|
| Boiling Point | 401.8ºC at 760 mmHg |
| Molecular Formula | C8H8BrNO2S |
| Molecular Weight | 262.12400 |
| Flash Point | 196.8ºC |
| Exact Mass | 260.94600 |
| PSA | 68.54000 |
| LogP | 3.44950 |
| Index of Refraction | 1.658 |
| InChIKey | ARMVTFGKGRFJNQ-SOFGYWHQSA-N |
| SMILES | NS(=O)(=O)C(Br)=Cc1ccccc1 |
| HS Code | 2935009090 |
|---|
|
~%
Ethenesulfonami... CAS#:64984-22-1 |
| Literature: Hasegawa,K. et al. Bulletin of the Chemical Society of Japan, 1977 , vol. 50, p. 2346 - 2350 |
|
~%
Ethenesulfonami... CAS#:64984-22-1 |
| Literature: Hasegawa,K. et al. Bulletin of the Chemical Society of Japan, 1977 , vol. 50, p. 2346 - 2350 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| Ethenesulfonamide,1-bromo-2-phenyl-,(Z)-(9CI) |
| (Z)-1-bromo-2-phenyl-ethenesulfonic acid amide |
| (Z)-1-BROMO-2-PHENYL-ETHENESULFONAMIDE |