2-[ethyl(2,2,2-trifluoroethoxy)phosphoryl]oxy-1,1,1-trifluoroethane structure
|
Common Name | 2-[ethyl(2,2,2-trifluoroethoxy)phosphoryl]oxy-1,1,1-trifluoroethane | ||
|---|---|---|---|---|
| CAS Number | 650-16-8 | Molecular Weight | 274.09800 | |
| Density | 1.389g/cm3 | Boiling Point | 184.9ºC at 760 mmHg | |
| Molecular Formula | C6H9F6O3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 65.6ºC | |
| Name | 2-[ethyl(2,2,2-trifluoroethoxy)phosphoryl]oxy-1,1,1-trifluoroethane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.389g/cm3 |
|---|---|
| Boiling Point | 184.9ºC at 760 mmHg |
| Molecular Formula | C6H9F6O3P |
| Molecular Weight | 274.09800 |
| Flash Point | 65.6ºC |
| Exact Mass | 274.01900 |
| PSA | 45.34000 |
| LogP | 3.35720 |
| Index of Refraction | 1.338 |
| InChIKey | LIKKZVFVRKNSHY-UHFFFAOYSA-N |
| SMILES | CCP(=O)(OCC(F)(F)F)OCC(F)(F)F |
|
~98%
2-[ethyl(2,2,2-... CAS#:650-16-8 |
| Literature: Synthesis, , # 2 p. 304 - 319 |
|
~61%
2-[ethyl(2,2,2-... CAS#:650-16-8 |
| Literature: Russian Journal of General Chemistry, , vol. 80, # 3 p. 434 - 439 |
| bis-trifluoroethyl ethylphosphonate |
| Bis-trifluoromethyl Ethylphosphonate |