2-[ethyl(2,2,2-trifluoroethoxy)phosphoryl]oxy-1,1,1-trifluoroethane
![2-[ethyl(2,2,2-trifluoroethoxy)phosphoryl]oxy-1,1,1-trifluoroethane Structure](https://image.chemsrc.com/caspic/212/650-16-8.png)
2-[ethyl(2,2,2-trifluoroethoxy)phosphoryl]oxy-1,1,1-trifluoroethane structure
|
Common Name | 2-[ethyl(2,2,2-trifluoroethoxy)phosphoryl]oxy-1,1,1-trifluoroethane | ||
|---|---|---|---|---|
| CAS Number | 650-16-8 | Molecular Weight | 274.09800 | |
| Density | 1.389g/cm3 | Boiling Point | 184.9ºC at 760 mmHg | |
| Molecular Formula | C6H9F6O3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 65.6ºC | |
Summary: 2-[ethyl(2,2,2-trifluoroethoxy)phosphoryl]oxy-1,1,1-trifluoroethane, Chinese name: 双三氟甲基乙基膦酸酯, CAS number: 650-16-8, molecular formula: C6H9F6O3P, molecular weight: 274.09800. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[ethyl(2,2,2-trifluoroethoxy)phosphoryl]oxy-1,1,1-trifluoroethane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.389g/cm3 |
|---|---|
| Boiling Point | 184.9ºC at 760 mmHg |
| Molecular Formula | C6H9F6O3P |
| Molecular Weight | 274.09800 |
| Flash Point | 65.6ºC |
| Exact Mass | 274.01900 |
| PSA | 45.34000 |
| LogP | 3.35720 |
| Index of Refraction | 1.338 |
| InChIKey | LIKKZVFVRKNSHY-UHFFFAOYSA-N |
| SMILES | CCP(=O)(OCC(F)(F)F)OCC(F)(F)F |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~98%
2-[ethyl(2,2,2-... CAS#:650-16-8 |
| Literature: Synthesis, , # 2 p. 304 - 319 |
|
~61%
2-[ethyl(2,2,2-... CAS#:650-16-8 |
| Literature: Russian Journal of General Chemistry, , vol. 80, # 3 p. 434 - 439 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 2 | |
![Ethyl 2-[Bis(2,2,2-Trifluoroethoxy)Phosphoryl]Propanoate structure](https://image.chemsrc.com/caspic/405/107905-52-2.png)
CAS#:107905-52-2![methyl 2-[bis(2,2,2-trifluoroethoxy)phosphoryl]propanoate structure](https://image.chemsrc.com/caspic/493/88738-84-5.png)
CAS#:88738-84-5This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| bis-trifluoroethyl ethylphosphonate |
| Bis-trifluoromethyl Ethylphosphonate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of 2-[ethyl(2,2,2-trifluoroethoxy)phosphoryl]oxy-1,1,1-trifluoroethane? |
| A: Boiling point of 2-[ethyl(2,2,2-trifluoroethoxy)phosphoryl]oxy-1,1,1-trifluoroethane is 184.9ºC at 760 mmHg. |
| Q: What are the downstream products of 2-[ethyl(2,2,2-trifluoroethoxy)phosphoryl]oxy-1,1,1-trifluoroethane? |
| A: Related downstream products(CAS) of 2-[ethyl(2,2,2-trifluoroethoxy)phosphoryl]oxy-1,1,1-trifluoroethane: 107905-52-2;88738-84-5. |
| Q: What is the CAS number of 2-[ethyl(2,2,2-trifluoroethoxy)phosphoryl]oxy-1,1,1-trifluoroethane? |
| A: CAS number of 2-[ethyl(2,2,2-trifluoroethoxy)phosphoryl]oxy-1,1,1-trifluoroethane is 650-16-8. |
| Q: What English synonyms does 2-[ethyl(2,2,2-trifluoroethoxy)phosphoryl]oxy-1,1,1-trifluoroethane have? |
| A: English synonyms of 2-[ethyl(2,2,2-trifluoroethoxy)phosphoryl]oxy-1,1,1-trifluoroethane: bis-trifluoroethyl ethylphosphonate, Bis-trifluoromethyl Ethylphosphonate. |
| Q: What is the SMILES notation of 2-[ethyl(2,2,2-trifluoroethoxy)phosphoryl]oxy-1,1,1-trifluoroethane? |
| A: SMILES notation of 2-[ethyl(2,2,2-trifluoroethoxy)phosphoryl]oxy-1,1,1-trifluoroethane is CCP(=O)(OCC(F)(F)F)OCC(F)(F)F. |
| Q: What is the InChIKey of 2-[ethyl(2,2,2-trifluoroethoxy)phosphoryl]oxy-1,1,1-trifluoroethane? |
| A: InChIKey of 2-[ethyl(2,2,2-trifluoroethoxy)phosphoryl]oxy-1,1,1-trifluoroethane is LIKKZVFVRKNSHY-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2-[ethyl(2,2,2-trifluoroethoxy)phosphoryl]oxy-1,1,1-trifluoroethane? |
| A: Molecular weight of 2-[ethyl(2,2,2-trifluoroethoxy)phosphoryl]oxy-1,1,1-trifluoroethane is 274.09800. |
| Q: What is the polar surface area (PSA) of 2-[ethyl(2,2,2-trifluoroethoxy)phosphoryl]oxy-1,1,1-trifluoroethane? |
| A: Polar surface area (PSA) of 2-[ethyl(2,2,2-trifluoroethoxy)phosphoryl]oxy-1,1,1-trifluoroethane is 45.34000. |
| Q: What is the English name of 2-[ethyl(2,2,2-trifluoroethoxy)phosphoryl]oxy-1,1,1-trifluoroethane? |
| A: The English name of 2-[ethyl(2,2,2-trifluoroethoxy)phosphoryl]oxy-1,1,1-trifluoroethane is 2-[ethyl(2,2,2-trifluoroethoxy)phosphoryl]oxy-1,1,1-trifluoroethane. |
| Q: What are the upstream materials of 2-[ethyl(2,2,2-trifluoroethoxy)phosphoryl]oxy-1,1,1-trifluoroethane? |
| A: Related upstream materials(CAS) of 2-[ethyl(2,2,2-trifluoroethoxy)phosphoryl]oxy-1,1,1-trifluoroethane: 75-89-8;1066-50-8. |