N-{2-[(2,4-Dibromo-6-methylphenyl)diazenyl]-5-(diethylamino)phenyl}acetamide
Modify Date: 2026-07-17 09:13:55
![N-{2-[(2,4-Dibromo-6-methylphenyl)diazenyl]-5-(diethylamino)phenyl}acetamide Structure](https://www.chemsrc.com/extcaspic/054/65000-75-1.png)
N-{2-[(2,4-Dibromo-6-methylphenyl)diazenyl]-5-(diethylamino)phenyl}acetamide structure
|
Common Name | N-{2-[(2,4-Dibromo-6-methylphenyl)diazenyl]-5-(diethylamino)phenyl}acetamide | ||
|---|---|---|---|---|
| CAS Number | 65000-75-1 | Molecular Weight | 482.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H22Br2N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-{2-[(2,4-Dibromo-6-methylphenyl)diazenyl]-5-(diethylamino)phenyl}acetamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H22Br2N4O |
|---|---|
| Molecular Weight | 482.2 |
| InChIKey | FLORBYDVLJCDDZ-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1ccc(N=Nc2c(C)cc(Br)cc2Br)c(NC(C)=O)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of N-{2-[(2,4-Dibromo-6-methylphenyl)diazenyl]-5-(diethylamino)phenyl}acetamide? |
| A: Molecular formula of N-{2-[(2,4-Dibromo-6-methylphenyl)diazenyl]-5-(diethylamino)phenyl}acetamide is C19H22Br2N4O. |
| Q: What is the CAS number of N-{2-[(2,4-Dibromo-6-methylphenyl)diazenyl]-5-(diethylamino)phenyl}acetamide? |
| A: CAS number of N-{2-[(2,4-Dibromo-6-methylphenyl)diazenyl]-5-(diethylamino)phenyl}acetamide is 65000-75-1. |
| Q: What is the Chinese name of 65000-75-1? |
| A: Chinese name of 65000-75-1 is 65000-75-1. |
| Q: What is the SMILES notation of N-{2-[(2,4-Dibromo-6-methylphenyl)diazenyl]-5-(diethylamino)phenyl}acetamide? |
| A: SMILES notation of N-{2-[(2,4-Dibromo-6-methylphenyl)diazenyl]-5-(diethylamino)phenyl}acetamide is CCN(CC)c1ccc(N=Nc2c(C)cc(Br)cc2Br)c(NC(C)=O)c1. |
| Q: What is the molecular weight of N-{2-[(2,4-Dibromo-6-methylphenyl)diazenyl]-5-(diethylamino)phenyl}acetamide? |
| A: Molecular weight of N-{2-[(2,4-Dibromo-6-methylphenyl)diazenyl]-5-(diethylamino)phenyl}acetamide is 482.2. |
| Q: What is the InChIKey of N-{2-[(2,4-Dibromo-6-methylphenyl)diazenyl]-5-(diethylamino)phenyl}acetamide? |
| A: InChIKey of N-{2-[(2,4-Dibromo-6-methylphenyl)diazenyl]-5-(diethylamino)phenyl}acetamide is FLORBYDVLJCDDZ-UHFFFAOYSA-N. |
| Q: What is the English name of N-{2-[(2,4-Dibromo-6-methylphenyl)diazenyl]-5-(diethylamino)phenyl}acetamide? |
| A: The English name of N-{2-[(2,4-Dibromo-6-methylphenyl)diazenyl]-5-(diethylamino)phenyl}acetamide is N-{2-[(2,4-Dibromo-6-methylphenyl)diazenyl]-5-(diethylamino)phenyl}acetamide. |