2-(2-methyl-1,3-thiazol-4-yl)benzoic acid structure
|
Common Name | 2-(2-methyl-1,3-thiazol-4-yl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 65032-66-8 | Molecular Weight | 219.26000 | |
| Density | 1.319 | Boiling Point | 380ºC | |
| Molecular Formula | C11H9NO2S | Melting Point | 145.5-146.5ºC | |
| MSDS | USA | Flash Point | 183ºC | |
| Name | 2-(2-methyl-1,3-thiazol-4-yl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.319 |
|---|---|
| Boiling Point | 380ºC |
| Melting Point | 145.5-146.5ºC |
| Molecular Formula | C11H9NO2S |
| Molecular Weight | 219.26000 |
| Flash Point | 183ºC |
| Exact Mass | 219.03500 |
| PSA | 78.43000 |
| LogP | 2.81670 |
| InChIKey | BNRSCIXYHUTATP-UHFFFAOYSA-N |
| SMILES | Cc1nc(-c2ccccc2C(=O)O)cs1 |
| Risk Phrases | 22-36/37/38 |
|---|---|
| Safety Phrases | 22-26-36/37/39 |
| HS Code | 2934100090 |
|
~%
2-(2-methyl-1,3... CAS#:65032-66-8 |
| Literature: Knott Journal of the Chemical Society, 1947 , p. 1656,1658 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Benzoic acid,2-(2-methyl-4-thiazolyl) |
| 2-(1-HYDRAZONO-3-PHENYL-ALLYL)-PHENOL |
| 2-(2-Methyl-thiazol-4-yl)-benzoesaeure |
| 4-(2-Carboxyphenyl)-2-methyl-1,3-thiazole |
| 2-(2-methyl-thiazol-4-yl)-benzoic acid |