1-Chloro-4-nitroisoquinoline structure
|
Common Name | 1-Chloro-4-nitroisoquinoline | ||
|---|---|---|---|---|
| CAS Number | 65092-53-7 | Molecular Weight | 208.60100 | |
| Density | 1.484g/cm3 | Boiling Point | 360.9ºC at 760 mmHg | |
| Molecular Formula | C9H5ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.1ºC | |
| Name | 1-Chloro-4-nitroisoquinoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.484g/cm3 |
|---|---|
| Boiling Point | 360.9ºC at 760 mmHg |
| Molecular Formula | C9H5ClN2O2 |
| Molecular Weight | 208.60100 |
| Flash Point | 172.1ºC |
| Exact Mass | 208.00400 |
| PSA | 58.71000 |
| LogP | 3.31960 |
| Index of Refraction | 1.688 |
| InChIKey | JMPCRAAJZFDSCH-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cnc(Cl)c2ccccc12 |
| Storage condition | -20°C |
|
~65%
1-Chloro-4-nitr... CAS#:65092-53-7 |
| Literature: ELI LILLY AND COMPANY Patent: WO2007/53346 A1, 2007 ; Location in patent: Page/Page column 19; 21 ; WO 2007/053346 A1 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-chloro-4-nitro-isoquinoline |
| QC-9413 |
| 1-Chlor-4-nitro-isochinolin |
| CL1039 |