dimethyl 4-prop-2-enoxybenzene-1,3-dicarboxylate structure
|
Common Name | dimethyl 4-prop-2-enoxybenzene-1,3-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 651027-60-0 | Molecular Weight | 250.24700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H14O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dimethyl 4-prop-2-enoxybenzene-1,3-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H14O5 |
|---|---|
| Molecular Weight | 250.24700 |
| Exact Mass | 250.08400 |
| PSA | 61.83000 |
| LogP | 1.82460 |
| InChIKey | SIYHJEGWZKNRIY-UHFFFAOYSA-N |
| SMILES | C=CCOc1ccc(C(=O)OC)cc1C(=O)OC |
|
~99%
dimethyl 4-prop... CAS#:651027-60-0 |
| Literature: Szalai, Michael L.; Kevwitch, Robert M.; McGrath, Dominic V. Journal of the American Chemical Society, 2003 , vol. 125, # 51 p. 15688 - 15689 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| dimethyl 4-allyloxyisophthalate |
| 1,3-Benzenedicarboxylic acid,4-(2-propenyloxy)-,dimethyl ester |
| 4-Allyloxy-isophthalsaeure-dimethylester |