Dimethyl 4-hydroxyisophthalate structure
|
Common Name | Dimethyl 4-hydroxyisophthalate | ||
|---|---|---|---|---|
| CAS Number | 5985-24-0 | Molecular Weight | 210.183 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 304.9±22.0 °C at 760 mmHg | |
| Molecular Formula | C10H10O5 | Melting Point | 97ºC | |
| MSDS | N/A | Flash Point | 117.0±15.8 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of Dimethyl 4-hydroxyisophthalateDimethyl 4-hydroxyisophthalate is a methyl salicylate analogue. |
| Name | Dimethyl 4-hydroxyisophthalate |
|---|---|
| Synonym | More Synonyms |
| Description | Dimethyl 4-hydroxyisophthalate is a methyl salicylate analogue. |
|---|---|
| Related Catalog |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 304.9±22.0 °C at 760 mmHg |
| Melting Point | 97ºC |
| Molecular Formula | C10H10O5 |
| Molecular Weight | 210.183 |
| Flash Point | 117.0±15.8 °C |
| Exact Mass | 210.052826 |
| PSA | 72.83000 |
| LogP | 2.89 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.544 |
| InChIKey | ALBUJVBOIXVVLS-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(O)c(C(=O)OC)c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S24/25 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2918199090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4-Hydroxy-isophthalic acid dimethyl ester |
| Isophthalic acid, 4-hydroxy-, dimethyl ester (8CI) |
| 1,3-Benzenedicarboxylic acid, 4-hydroxy-, dimethyl ester |
| 4-Hydroxyisophthalic acid dimethyl ester |
| Isophthalic acid, 4-hydroxy-, dimethyl ester |
| Dimethyl 4-hydroxyisophthalate |
| dimethyl 4-hydroxybenzene-1,3-dicarboxylate |