4-[C-[4-(dimethylamino)phenyl]carbonohydrazonoyl]-N,N-dimethylaniline structure
|
Common Name | 4-[C-[4-(dimethylamino)phenyl]carbonohydrazonoyl]-N,N-dimethylaniline | ||
|---|---|---|---|---|
| CAS Number | 65111-92-4 | Molecular Weight | 282.38300 | |
| Density | 1.05g/cm3 | Boiling Point | 443.5ºC at 760mmHg | |
| Molecular Formula | C17H22N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222ºC | |
| Name | 4-[C-[4-(dimethylamino)phenyl]carbonohydrazonoyl]-N,N-dimethylaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.05g/cm3 |
|---|---|
| Boiling Point | 443.5ºC at 760mmHg |
| Molecular Formula | C17H22N4 |
| Molecular Weight | 282.38300 |
| Flash Point | 222ºC |
| Exact Mass | 282.18400 |
| PSA | 44.86000 |
| LogP | 3.23000 |
| Index of Refraction | 1.567 |
| InChIKey | PCZXDDXEYBFQIQ-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(C(=NN)c2ccc(N(C)C)cc2)cc1 |
|
~77%
4-[C-[4-(dimeth... CAS#:65111-92-4 |
| Literature: Huenig, Siegfried; Aldenkortt, Sven; Baeuerle, Peter; Briehn, Christoph A.; Schaeferling, Michael; Perepichka, Igor F.; Stalke, Dietmar; Walfort, Bernhard European Journal of Organic Chemistry, 2002 , # 10 p. 1603 - 1614 |
|
~82%
4-[C-[4-(dimeth... CAS#:65111-92-4 |
| Literature: Huenig, Siegfried; Kemmer, Martina; Wenner, Hermann; Barbosa, Frederique; Gescheidt, Georg; Perepichka, Igor F.; Baeuerle, Peter; Emge, Andreas; Peters, Karl Chemistry--A European Journal, 2000 , vol. 6, # 14 p. 2618 - 2632 |
| Methanone,bis(4-(dimethylamino)phenyl)-,hydrazide |
| bis(4-dimethylaminophenyl)methanone hydrazone |
| 4,4'-bis-dimethylamino-benzophenone hydrazone |
| Michler's ketone hydrazone |
| bis[4-(dimethylamino)phenyl]-methanon-hydrazone |
| bis(p-dimethylaminobenzophenone) hydrazone |
| Bis(4-(dimethylamino)phenyl)methanone hydrazide |
| 4,4'-Bis-dimethylaminobenzophenonhydrazon |