UNII:5K6L8O868Y structure
|
Common Name | UNII:5K6L8O868Y | ||
|---|---|---|---|---|
| CAS Number | 6515-37-3 | Molecular Weight | 240.25 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 447.5±45.0 °C at 760 mmHg | |
| Molecular Formula | C15H12O3 | Melting Point | 182°C | |
| MSDS | N/A | Flash Point | 174.0±22.2 °C | |
Use of UNII:5K6L8O868Y4'-Hydroxyflavanone is an inhibitor of SREBP maturation and lipid synthesis. 4'-Hydroxyflavanone is a synthetic analogue of flavanone, has potential for hepatic steatosis and dyslipidemia research[1]. |
| Name | 4'-hydroxyflavanone |
|---|---|
| Synonym | More Synonyms |
| Description | 4'-Hydroxyflavanone is an inhibitor of SREBP maturation and lipid synthesis. 4'-Hydroxyflavanone is a synthetic analogue of flavanone, has potential for hepatic steatosis and dyslipidemia research[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 447.5±45.0 °C at 760 mmHg |
| Melting Point | 182°C |
| Molecular Formula | C15H12O3 |
| Molecular Weight | 240.25 |
| Flash Point | 174.0±22.2 °C |
| Exact Mass | 240.078644 |
| PSA | 46.53000 |
| LogP | 2.88 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.632 |
| InChIKey | ZLHVIYHWWQYJID-UHFFFAOYSA-N |
| SMILES | O=C1CC(c2ccc(O)cc2)Oc2ccccc21 |
| WGK Germany | 3 |
|---|---|
| HS Code | 2932999099 |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4'-HYDROXYFLAVANONE |
| 4H-1-Benzopyran-4-one, 2,3-dihydro-2-(4-hydroxyphenyl)- |
| UNII:5K6L8O868Y |
| MFCD00017705 |
| 2-(4-Hydroxyphenyl)-2,3-dihydro-4H-chromen-4-one |
| 2-(4-HYDROXY-PHENYL)-CHROMAN-4-ONE |
| 2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-one |
| 4'-hydroxy flavanone |