3,4-Dimethyl-5-nitrophenol structure
|
Common Name | 3,4-Dimethyl-5-nitrophenol | ||
|---|---|---|---|---|
| CAS Number | 65151-58-8 | Molecular Weight | 167.162 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 306.8±30.0 °C at 760 mmHg | |
| Molecular Formula | C8H9NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 137.3±13.0 °C | |
| Name | 3,4-Dimethyl-5-nitrophenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 306.8±30.0 °C at 760 mmHg |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.162 |
| Flash Point | 137.3±13.0 °C |
| Exact Mass | 167.058243 |
| PSA | 66.05000 |
| LogP | 2.85 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.585 |
| InChIKey | HKQSKINMCHAPPJ-UHFFFAOYSA-N |
| SMILES | Cc1cc(O)cc([N+](=O)[O-])c1C |
| Storage condition | 2-8°C |
| HS Code | 2908999090 |
|---|
|
~%
3,4-Dimethyl-5-... CAS#:65151-58-8 |
| Literature: Aleksandrov,I.V.; Abraduschkin,Yu.S. J. Gen. Chem. USSR (Engl. Transl.), 1960 , vol. 30, # 10 p. 3407 - 3412,3374 - 3379 |
|
~%
3,4-Dimethyl-5-... CAS#:65151-58-8 |
| Literature: Aleksandrov,I.V.; Abraduschkin,Yu.S. J. Gen. Chem. USSR (Engl. Transl.), 1960 , vol. 30, # 10 p. 3407 - 3412,3374 - 3379 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 5-Hydroxy-3-nitro-1,2-xylene |
| 3,4-Dimethyl-5-nitrophenol |
| Phenol, 3,4-dimethyl-5-nitro- |
| 3-Nitro-5-hydroxy-1,2-dimethyl-benzol |