3,4-Dimethyl-5-nitroaniline structure
|
Common Name | 3,4-Dimethyl-5-nitroaniline | ||
|---|---|---|---|---|
| CAS Number | 64823-22-9 | Molecular Weight | 166.177 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 331.3±37.0 °C at 760 mmHg | |
| Molecular Formula | C8H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154.1±26.5 °C | |
| Name | 3,4-Dimethyl-5-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 331.3±37.0 °C at 760 mmHg |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.177 |
| Flash Point | 154.1±26.5 °C |
| Exact Mass | 166.074234 |
| PSA | 71.84000 |
| LogP | 2.29 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.602 |
| InChIKey | LRWWBVBRBWPHBA-UHFFFAOYSA-N |
| SMILES | Cc1cc(N)cc([N+](=O)[O-])c1C |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2921430090 |
|
~%
3,4-Dimethyl-5-... CAS#:64823-22-9 |
| Literature: Aleksandrov,I.V.; Abraduschkin,Yu.S. J. Gen. Chem. USSR (Engl. Transl.), 1960 , vol. 30, # 10 p. 3407 - 3412,3374 - 3379 |
|
~%
3,4-Dimethyl-5-... CAS#:64823-22-9 |
| Literature: Noelting; Braun; Thesmar Chemische Berichte, 1901 , vol. 34, p. 2255 |
|
~%
3,4-Dimethyl-5-... CAS#:64823-22-9 |
| Literature: Mann; Porter Journal of the Chemical Society, 1947 , p. 910,912 |
|
~%
3,4-Dimethyl-5-... CAS#:64823-22-9 |
| Literature: Mann; Porter Journal of the Chemical Society, 1947 , p. 910,912 |
|
~%
3,4-Dimethyl-5-... CAS#:64823-22-9 |
| Literature: Noelting; Braun; Thesmar Chemische Berichte, 1901 , vol. 34, p. 2255 |
| HS Code | 2921430090 |
|---|---|
| Summary | HS:2921430090 toluidines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 3,4-Dimethyl-5-nitroaniline |
| Benzenamine,3,4-dimethyl-5-nitro |
| 3-Nitro-5-amino-1,2-dimethyl-benzol |
| 5-Amino-3-nitro-o-xylol |
| 3,4-dimethyl-5-nitro-benzenamine |
| 6-Nitro-4-amino-o-xylol |
| 3,4-dimethyl-5-nitro-aniline |
| 5-Amino-3-nitro-1,2-xylene |
| Benzenamine, 3,4-dimethyl-5-nitro- |