Esermethole
Esermethole structure
|
Common Name | Esermethole | ||
|---|---|---|---|---|
| CAS Number | 65166-97-4 | Molecular Weight | 232.32100 | |
| Density | 1.087g/cm3 | Boiling Point | 348.1ºC at 760 mmHg | |
| Molecular Formula | C14H20N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 103.8ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (3aR,8bS)-7-methoxy-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indole |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.087g/cm3 |
|---|---|
| Boiling Point | 348.1ºC at 760 mmHg |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.32100 |
| Flash Point | 103.8ºC |
| Exact Mass | 232.15800 |
| PSA | 15.71000 |
| LogP | 2.06720 |
| Index of Refraction | 1.558 |
| InChIKey | WKJDLYATGMSVOQ-KGLIPLIRSA-N |
| SMILES | COc1ccc2c(c1)C1(C)CCN(C)C1N2C |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:57-47-6
CAS#:101246-66-6This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Esermethole |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of (3aR,8bS)-7-methoxy-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indole? |
| A: SMILES notation of (3aR,8bS)-7-methoxy-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indole is COc1ccc2c(c1)C1(C)CCN(C)C1N2C. |
| Q: What is the InChIKey of (3aR,8bS)-7-methoxy-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indole? |
| A: InChIKey of (3aR,8bS)-7-methoxy-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indole is WKJDLYATGMSVOQ-KGLIPLIRSA-N. |
| Q: What is the molecular formula of (3aR,8bS)-7-methoxy-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indole? |
| A: Molecular formula of (3aR,8bS)-7-methoxy-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indole is C14H20N2O. |
| Q: What is the polar surface area (PSA) of (3aR,8bS)-7-methoxy-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indole? |
| A: Polar surface area (PSA) of (3aR,8bS)-7-methoxy-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indole is 15.71000. |
| Q: What English synonyms does (3aR,8bS)-7-methoxy-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indole have? |
| A: English synonyms of (3aR,8bS)-7-methoxy-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indole: Esermethole. |
| Q: What is the LogP of (3aR,8bS)-7-methoxy-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indole? |
| A: LogP of (3aR,8bS)-7-methoxy-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indole is 2.06720. |
| Q: What is the Chinese name of 65166-97-4? |
| A: Chinese name of 65166-97-4 is 65166-97-4. |
| Q: What are the downstream products of (3aR,8bS)-7-methoxy-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indole? |
| A: Related downstream products(CAS) of (3aR,8bS)-7-methoxy-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indole: 57-47-6;101246-66-6. |
| Q: What is the molecular weight of (3aR,8bS)-7-methoxy-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indole? |
| A: Molecular weight of (3aR,8bS)-7-methoxy-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indole is 232.32100. |
| Q: What is the CAS number of (3aR,8bS)-7-methoxy-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indole? |
| A: CAS number of (3aR,8bS)-7-methoxy-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indole is 65166-97-4. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |