3,4,5,6-Tetrafluorophthalic acid structure
|
Common Name | 3,4,5,6-Tetrafluorophthalic acid | ||
|---|---|---|---|---|
| CAS Number | 652-03-9 | Molecular Weight | 238.093 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 345.7±42.0 °C at 760 mmHg | |
| Molecular Formula | C8H2F4O4 | Melting Point | 152-154 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 162.9±27.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Tetrafluorophthalic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 345.7±42.0 °C at 760 mmHg |
| Melting Point | 152-154 °C(lit.) |
| Molecular Formula | C8H2F4O4 |
| Molecular Weight | 238.093 |
| Flash Point | 162.9±27.9 °C |
| Exact Mass | 237.988922 |
| PSA | 74.60000 |
| LogP | 1.82 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.523 |
| InChIKey | YJLVXRPNNDKMMO-UHFFFAOYSA-N |
| SMILES | O=C(O)c1c(F)c(F)c(F)c(F)c1C(=O)O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2917399090 |
| Precursor 9 | |
|---|---|
| DownStream 6 | |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Name: Discovery of Small Molecules to Inhibit Human Cytomegalovirus Nuclear Egress
Source: ICCB-Longwood/NSRB Screening Facility, Harvard Medical School
Target: HCMV UL50
External Id: HMS1262
|
|
Name: Dicer-mediated maturation of pre-microRNA
Source: Center for Chemical Genomics, University of Michigan
Target: N/A
External Id: TargetID_659_CEMA
|
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
| EINECS 211-483-4 |
| 3,4,5,6-tetrafluorobenzene-1,2-dicarboxylic acid |
| MFCD00002407 |
| 3,4,5,6-Tetrafluorophthalic acid |