Benzamide,2,3,4,5,6-pentafluoro- structure
|
Common Name | Benzamide,2,3,4,5,6-pentafluoro- | ||
|---|---|---|---|---|
| CAS Number | 652-31-3 | Molecular Weight | 211.08900 | |
| Density | 1.634g/cm3 | Boiling Point | 89.4ºC at 760 mmHg | |
| Molecular Formula | C7H2F5NO | Melting Point | 146-149 °C(lit.) | |
| MSDS | N/A | Flash Point | 7.8ºC | |
| Name | 2,3,4,5,6-pentafluorobenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.634g/cm3 |
|---|---|
| Boiling Point | 89.4ºC at 760 mmHg |
| Melting Point | 146-149 °C(lit.) |
| Molecular Formula | C7H2F5NO |
| Molecular Weight | 211.08900 |
| Flash Point | 7.8ºC |
| Exact Mass | 211.00600 |
| PSA | 43.09000 |
| LogP | 2.18130 |
| Index of Refraction | 1.456 |
| InChIKey | WPWWHXPRJFDTTJ-UHFFFAOYSA-N |
| SMILES | NC(=O)c1c(F)c(F)c(F)c(F)c1F |
| Hazard Codes | Xi:Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| WGK Germany | 3 |
| HS Code | 2924299090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Pentafluorobenzamide |
| perfluorobenzamide |
| Benzamide,pentafluoro |
| pentafluorobenzoyl amide |
| Benzamide,2,3,4,5,6-pentafluoro |
| EINECS 211-488-1 |
| 2,3,4,5,6-pentafluoro-benzamide |
| 2,3',4,4',5-PENTACHLOROBIPHENYL SOLUTION |
| MFCD00007971 |