Benzoic acid,2,3,5,6-tetrafluoro-4-methyl structure
|
Common Name | Benzoic acid,2,3,5,6-tetrafluoro-4-methyl | ||
|---|---|---|---|---|
| CAS Number | 652-32-4 | Molecular Weight | 208.11000 | |
| Density | 1.54 g/cm3 | Boiling Point | 255.8ºC at 760 mmHg | |
| Molecular Formula | C8H4F4O2 | Melting Point | 173-175 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 108.5ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2,3,5,6-tetrafluoro-4-methylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.54 g/cm3 |
|---|---|
| Boiling Point | 255.8ºC at 760 mmHg |
| Melting Point | 173-175 °C(lit.) |
| Molecular Formula | C8H4F4O2 |
| Molecular Weight | 208.11000 |
| Flash Point | 108.5ºC |
| Exact Mass | 208.01500 |
| PSA | 37.30000 |
| LogP | 2.24960 |
| InChIKey | COOULIOYEXBFDT-UHFFFAOYSA-N |
| SMILES | Cc1c(F)c(F)c(C(=O)O)c(F)c1F |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant;C: Corrosive; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2916399090 |
|
~%
Benzoic acid,2,... CAS#:652-32-4 |
| Literature: US4370346 A1, ; |
|
~%
Benzoic acid,2,... CAS#:652-32-4 |
| Literature: EP266947 B1, ; |
|
~%
Benzoic acid,2,... CAS#:652-32-4 |
| Literature: Journal of Organic Chemistry, , vol. 31, p. 746 - 749 |
|
~%
Benzoic acid,2,... CAS#:652-32-4 |
| Literature: Journal of the Chemical Society, , p. 1801 - 1805 |
|
~%
Benzoic acid,2,... CAS#:652-32-4 |
| Literature: Journal of Organic Chemistry, , vol. 31, p. 746 - 749 |
|
~%
Benzoic acid,2,... CAS#:652-32-4 |
| Literature: Journal of the Chemical Society, , p. 1801 - 1805 |
|
~%
Benzoic acid,2,... CAS#:652-32-4 |
| Literature: Journal of Organic Chemistry, , vol. 31, p. 746 - 749 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2,3,5,6-Tetrafluoro-p-toluic acid |
| 2,3,5,6-tetrafluoro-4-toluic acid |
| 4-methyl-2,3,5,6-tetrafluorobenzoic acid |
| 2,3,4,5-TETRAFLUOROTOLUENE |
| perfluoro-4-methylbenzoic acid |
| 2,3,5,6-Tetrafluor-4-methyl-benzoesaeure |
| MFCD00012302 |