20-alfa-Dhydrodydrogesterone
20-alfa-Dhydrodydrogesterone structure
|
Common Name | 20-alfa-Dhydrodydrogesterone | ||
|---|---|---|---|---|
| CAS Number | 652-69-7 | Molecular Weight | 332.477 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 487.1±45.0 °C at 760 mmHg | |
| Molecular Formula | C21H32O3 | Melting Point | 204-206ºC | |
| MSDS | N/A | Flash Point | 262.5±25.2 °C | |
Summary: Chinese name: 4-孕烯-17α,20α-二醇-3-酮; English name: (20S)-17,20-dihydroxypregn-4-en-3-one; CAS number: 652-69-7; Molecular formula: C21H32O3; Molecular weight: 332.477. The melting point is 204-206°C, boiling point is 487.1±45.0 °C, and density is 1.2±0.1 g/cm3. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (20S)-17,20-dihydroxypregn-4-en-3-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 487.1±45.0 °C at 760 mmHg |
| Melting Point | 204-206ºC |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.477 |
| Flash Point | 262.5±25.2 °C |
| Exact Mass | 332.235138 |
| PSA | 57.53000 |
| LogP | 2.88 |
| Vapour Pressure | 0.0±2.8 mmHg at 25°C |
| Index of Refraction | 1.568 |
| InChIKey | MASCESDECGBIBB-HNXXTFFGSA-N |
| SMILES | CC(O)C1(O)CCC2C3CCC4=CC(=O)CCC4(C)C3CCC21C |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:68-96-2This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (20S)-17,20-Dihydroxypregn-4-en-3-one |
| 20|A-Dihydroxyprogesterone |
| 17|A-Hydroxy-20|A-dihydroprogesterone |
| (8R,9S,10R,13S,14S,17R)-17-hydroxy-17-[(1S)-1-hydroxyethyl]-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| 17alpha,20alpha-Dihydroxypregn-4-en-3-one |
| 17|A,20|A-Dihydroxy-4-pregnen-3-one |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of (20S)-17,20-dihydroxypregn-4-en-3-one? |
| A: Related downstream products(CAS) of (20S)-17,20-dihydroxypregn-4-en-3-one: 68-96-2. |
| Q: What is the LogP of (20S)-17,20-dihydroxypregn-4-en-3-one? |
| A: LogP of (20S)-17,20-dihydroxypregn-4-en-3-one is 2.88. |
| Q: What is the polar surface area (PSA) of (20S)-17,20-dihydroxypregn-4-en-3-one? |
| A: Polar surface area (PSA) of (20S)-17,20-dihydroxypregn-4-en-3-one is 57.53000. |
| Q: What is the molecular weight of (20S)-17,20-dihydroxypregn-4-en-3-one? |
| A: Molecular weight of (20S)-17,20-dihydroxypregn-4-en-3-one is 332.477. |
| Q: What is the boiling point of (20S)-17,20-dihydroxypregn-4-en-3-one? |
| A: Boiling point of (20S)-17,20-dihydroxypregn-4-en-3-one is 487.1±45.0 °C at 760 mmHg. |
| Q: What is the melting point of (20S)-17,20-dihydroxypregn-4-en-3-one? |
| A: Melting point of (20S)-17,20-dihydroxypregn-4-en-3-one is 204-206ºC. |
| Q: What is the molecular formula of (20S)-17,20-dihydroxypregn-4-en-3-one? |
| A: Molecular formula of (20S)-17,20-dihydroxypregn-4-en-3-one is C21H32O3. |
| Q: What English synonyms does (20S)-17,20-dihydroxypregn-4-en-3-one have? |
| A: English synonyms of (20S)-17,20-dihydroxypregn-4-en-3-one: (20S)-17,20-Dihydroxypregn-4-en-3-one, 20|A-Dihydroxyprogesterone, 17|A-Hydroxy-20|A-dihydroprogesterone, (8R,9S,10R,13S,14S,17R)-17-hydroxy-17-[(1S)-1-hydroxyethyl]-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one, 17alpha,20alpha-Dihydroxypregn-4-en-3-one, 17|A,20|A-Dihydroxy-4-pregnen-3-one. |
| Q: What is the SMILES notation of (20S)-17,20-dihydroxypregn-4-en-3-one? |
| A: SMILES notation of (20S)-17,20-dihydroxypregn-4-en-3-one is CC(O)C1(O)CCC2C3CCC4=CC(=O)CCC4(C)C3CCC21C. |
| Q: What is the InChIKey of (20S)-17,20-dihydroxypregn-4-en-3-one? |
| A: InChIKey of (20S)-17,20-dihydroxypregn-4-en-3-one is MASCESDECGBIBB-HNXXTFFGSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |