[2,3,4,5,6-penta(hexanoyloxy)phenyl] hexanoate structure
|
Common Name | [2,3,4,5,6-penta(hexanoyloxy)phenyl] hexanoate | ||
|---|---|---|---|---|
| CAS Number | 65201-69-6 | Molecular Weight | 762.96600 | |
| Density | 1.072g/cm3 | Boiling Point | 762.6ºC at 760mmHg | |
| Molecular Formula | C42H66O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 298.7ºC | |
| Name | [2,3,4,5,6-penta(hexanoyloxy)phenyl] hexanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.072g/cm3 |
|---|---|
| Boiling Point | 762.6ºC at 760mmHg |
| Molecular Formula | C42H66O12 |
| Molecular Weight | 762.96600 |
| Flash Point | 298.7ºC |
| Exact Mass | 762.45500 |
| PSA | 157.80000 |
| LogP | 10.60080 |
| Index of Refraction | 1.489 |
| InChIKey | GUERWKLSTJCDLZ-UHFFFAOYSA-N |
| SMILES | CCCCCC(=O)Oc1c(OC(=O)CCCCC)c(OC(=O)CCCCC)c(OC(=O)CCCCC)c(OC(=O)CCCCC)c1OC(=O)CCCCC |
|
~%
[2,3,4,5,6-pent... CAS#:65201-69-6 |
| Literature: Neifert; Bartow Journal of the American Chemical Society, 1943 , vol. 65, p. 1770 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Hexahexanoyloxy-benzol |
| hexakis-hexanoyloxy-benzene |
| benzenehexoyl hexa-n-hexanoate |
| Hexakis-hexanoyloxy-benzol |
| Benzene-hexa-n-hexanoate |
| benzene-hexa-hexanoate |