Phenanthridinium, 5-methyl-, chloride (1:1) structure
|
Common Name | Phenanthridinium, 5-methyl-, chloride (1:1) | ||
|---|---|---|---|---|
| CAS Number | 65201-98-1 | Molecular Weight | 229.70500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12ClN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-methylphenanthridin-5-ium,chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H12ClN |
|---|---|
| Molecular Weight | 229.70500 |
| Exact Mass | 229.06600 |
| PSA | 3.88000 |
| InChIKey | CDIPADBUKXVJFU-UHFFFAOYSA-M |
| SMILES | C[n+]1cc2ccccc2c2ccccc21.[Cl-] |
|
~%
Phenanthridiniu... CAS#:65201-98-1 |
| Literature: Bunting, John W.; Luscher, Mark A. Canadian Journal of Chemistry, 1988 , vol. 66, p. 2524 - 2531 |
|
~%
Phenanthridiniu... CAS#:65201-98-1 |
| Literature: Bunting, John W.; Luscher, Mark A. Canadian Journal of Chemistry, 1988 , vol. 66, p. 2524 - 2531 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-methylphenanthridinium chloride |
| 5-Methyl-phenanthridinium,Chlorid |
| Phenanthridinium,5-methyl-,chloride |
| N-Methylphenanthridinium chloride |
| 5-methylphenanthridin-5-ium chloride |