2-[(2-chlorophenothiazine-10-carbonyl)-[2-(methylcarbamoyloxy)ethyl]amino]ethyl N-methylcarbamate structure
|
Common Name | 2-[(2-chlorophenothiazine-10-carbonyl)-[2-(methylcarbamoyloxy)ethyl]amino]ethyl N-methylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 65241-03-4 | Molecular Weight | 478.94900 | |
| Density | 1.379g/cm3 | Boiling Point | 668.1ºC at 760 mmHg | |
| Molecular Formula | C21H23ClN4O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 357.9ºC | |
| Name | 2-[(2-chlorophenothiazine-10-carbonyl)-[2-(methylcarbamoyloxy)ethyl]amino]ethyl N-methylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.379g/cm3 |
|---|---|
| Boiling Point | 668.1ºC at 760 mmHg |
| Molecular Formula | C21H23ClN4O5S |
| Molecular Weight | 478.94900 |
| Flash Point | 357.9ºC |
| Exact Mass | 478.10800 |
| PSA | 132.49000 |
| LogP | 4.55050 |
| Index of Refraction | 1.619 |
| InChIKey | IPHHAKZHHLDMOF-UHFFFAOYSA-N |
| SMILES | CNC(=O)OCCN(CCOC(=O)NC)C(=O)N1c2ccccc2Sc2ccc(Cl)cc21 |
|
~%
2-[(2-chlorophe... CAS#:65241-03-4 |
| Literature: Lambrou; Tsatsas; Champagnac; Pommier European Journal of Medicinal Chemistry, 1977 , vol. 12, # 5 p. 488 - 488 |
|
~%
2-[(2-chlorophe... CAS#:65241-03-4 |
| Literature: Lambrou; Tsatsas; Champagnac; Pommier European Journal of Medicinal Chemistry, 1977 , vol. 12, # 5 p. 488 - 488 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 10H-Phenothiazine-10-carboxamide,N,N-bis(2-(((methylamino)carbonyl)oxy)ethyl)-2-chloro |
| N,N-Bis(2-(((methylamino)carbonyl)oxy)ethyl)-2-chloro-10H-phenothiazine-10-carboxamide |
| 2-chloro-phenothiazine-10-carboxylic acid bis-(2-methylcarbamoyloxy-ethyl)-amide |