N-Dipropyldopamine hydrobromide structure
|
Common Name | N-Dipropyldopamine hydrobromide | ||
|---|---|---|---|---|
| CAS Number | 65273-66-7 | Molecular Weight | 318.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H24BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of N-Dipropyldopamine hydrobromideN. N-dipropyrldopamine is a potent inhibitor of glutamate release and has anticancer activity. The increase of glutamate secretion leads to cancer-induced bone pain (CIBP). N. N-dipropyrldopamine plays an analgesic role in CIBP[1]. |
| Name | 4-[2-(dipropylamino)ethyl]benzene-1,2-diol,hydrobromide |
|---|---|
| Synonym | More Synonyms |
| Description | N. N-dipropyrldopamine is a potent inhibitor of glutamate release and has anticancer activity. The increase of glutamate secretion leads to cancer-induced bone pain (CIBP). N. N-dipropyrldopamine plays an analgesic role in CIBP[1]. |
|---|---|
| Related Catalog | |
| Target |
cystine/glutamate transporter (XC-)[1]IC50:25.45 μM (cystine/glutamate transporter, XC-)[1] |
| References |
| Molecular Formula | C14H24BrNO2 |
|---|---|
| Molecular Weight | 318.25 |
| Exact Mass | 317.09900 |
| PSA | 43.70000 |
| LogP | 3.72040 |
| InChIKey | QAXMCYJNFHCJFB-UHFFFAOYSA-N |
| SMILES | Br.CCCN(CCC)CCc1ccc(O)c(O)c1 |
| WGK Germany | 3 |
|---|---|
| RTECS | RB5962000 |
| HS Code | 2922299090 |
|
~89%
N-Dipropyldopam... CAS#:65273-66-7 |
| Literature: Casagrande; Santangelo; Saini; Doggi; Gerli; Cerri Arzneimittel-Forschung/Drug Research, 1986 , vol. 36, # 2 A p. 291 - 303 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3,4-dihydroxy-N,N-di-(n-propyl)phenethylamine hydrobromide |
| N,N-Dipropyldopamine |
| N,N-di-n-propyldopamine hydrobromide |
| N,N-Dipropyldopamine hydrobromide |
| Dipropyldopamine hydrobromide |
| N,N-di-n-propyldopamine |