1-(morpholin-4-ylmethyl)indole-2,3-dione structure
|
Common Name | 1-(morpholin-4-ylmethyl)indole-2,3-dione | ||
|---|---|---|---|---|
| CAS Number | 6532-16-7 | Molecular Weight | 246.26200 | |
| Density | 1.332g/cm3 | Boiling Point | 407.1ºC at 760 mmHg | |
| Molecular Formula | C13H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200ºC | |
| Name | 1-(morpholin-4-ylmethyl)indole-2,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.332g/cm3 |
|---|---|
| Boiling Point | 407.1ºC at 760 mmHg |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.26200 |
| Flash Point | 200ºC |
| Exact Mass | 246.10000 |
| PSA | 49.85000 |
| LogP | 0.50850 |
| Index of Refraction | 1.608 |
| InChIKey | ZRUIMDMDIRQCKV-UHFFFAOYSA-N |
| SMILES | O=C1C(=O)N(CN2CCOCC2)c2ccccc21 |
| HS Code | 2934999090 |
|---|
|
~69%
1-(morpholin-4-... CAS#:6532-16-7 |
| Literature: Solomon, V. Raja; Hu, Changkun; Lee, Hoyun Bioorganic and Medicinal Chemistry, 2009 , vol. 17, # 21 p. 7585 - 7592 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Isatin-based compound,61 |
| 1-Morpholin-4-ylmethyl-1H-indole-2,3-dione |
| 1-(4-morpholinylmethyl)-1H-indole-2,3-dione |
| 1-(N-Morpholinomethyl)isatin |
| 1-morpholin-4-ylmethyl-indole-2,3-dione |
| 1-(morpholinomethyl)isatin |
| N-(morpholinomethyl)isatin |