2,4-Diamino-5-(2,4-dichlorobenzyl)pyrimidine structure
|
Common Name | 2,4-Diamino-5-(2,4-dichlorobenzyl)pyrimidine | ||
|---|---|---|---|---|
| CAS Number | 65321-42-8 | Molecular Weight | 269.13000 | |
| Density | 1.465g/cm3 | Boiling Point | 507.97ºC at 760 mmHg | |
| Molecular Formula | C11H10Cl2N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 261.011ºC | |
| Name | 5-[(2,4-dichlorophenyl)methyl]pyrimidine-2,4-diamine |
|---|
| Density | 1.465g/cm3 |
|---|---|
| Boiling Point | 507.97ºC at 760 mmHg |
| Molecular Formula | C11H10Cl2N4 |
| Molecular Weight | 269.13000 |
| Flash Point | 261.011ºC |
| Exact Mass | 268.02800 |
| PSA | 77.82000 |
| LogP | 3.70100 |
| Index of Refraction | 1.687 |
| InChIKey | CKKVFDQYOWXYQH-UHFFFAOYSA-N |
| SMILES | Nc1ncc(Cc2ccc(Cl)cc2Cl)c(N)n1 |
| HS Code | 2933599090 |
|---|
|
~%
2,4-Diamino-5-(... CAS#:65321-42-8 |
| Literature: Selassie, Cynthia Dias; Gan, Wei-Xi; Kallander, Lara S.; Klein, Teri E. Journal of Medicinal Chemistry, 1998 , vol. 41, # 22 p. 4261 - 4272 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |