5-fluoro-4-(carboxymethylthio)uracil
Modify Date: 2026-07-07 23:18:16
5-fluoro-4-(carboxymethylthio)uracil structure
|
Common Name | 5-fluoro-4-(carboxymethylthio)uracil | ||
|---|---|---|---|---|
| CAS Number | 654-92-2 | Molecular Weight | 204.17900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H5FN2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-fluoro-4-(carboxymethylthio)uracil |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H5FN2O3S |
|---|---|
| Molecular Weight | 204.17900 |
| Exact Mass | 204.00000 |
| PSA | 108.35000 |
| LogP | 0.08570 |
| InChIKey | ZQIPWORULMMNTD-UHFFFAOYSA-N |
| SMILES | CSc1nc(C(=O)O)c(F)c(=O)[nH]1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 5-fluoro-4-(carboxymethylthio)uracil? |
| A: SMILES notation of 5-fluoro-4-(carboxymethylthio)uracil is CSc1nc(C(=O)O)c(F)c(=O)[nH]1. |
| Q: What is the polar surface area (PSA) of 5-fluoro-4-(carboxymethylthio)uracil? |
| A: Polar surface area (PSA) of 5-fluoro-4-(carboxymethylthio)uracil is 108.35000. |
| Q: What is the safety information for 5-fluoro-4-(carboxymethylthio)uracil? |
| A: Safety information for 5-fluoro-4-(carboxymethylthio)uracil: S26-S36. |
| Q: What is the InChIKey of 5-fluoro-4-(carboxymethylthio)uracil? |
| A: InChIKey of 5-fluoro-4-(carboxymethylthio)uracil is ZQIPWORULMMNTD-UHFFFAOYSA-N. |
| Q: What is the LogP of 5-fluoro-4-(carboxymethylthio)uracil? |
| A: LogP of 5-fluoro-4-(carboxymethylthio)uracil is 0.08570. |
| Q: What is the molecular formula of 5-fluoro-4-(carboxymethylthio)uracil? |
| A: Molecular formula of 5-fluoro-4-(carboxymethylthio)uracil is C6H5FN2O3S. |
| Q: What is the CAS number of 5-fluoro-4-(carboxymethylthio)uracil? |
| A: CAS number of 5-fluoro-4-(carboxymethylthio)uracil is 654-92-2. |
| Q: What is the molecular weight of 5-fluoro-4-(carboxymethylthio)uracil? |
| A: Molecular weight of 5-fluoro-4-(carboxymethylthio)uracil is 204.17900. |
| Q: What is the English name of 5-fluoro-4-(carboxymethylthio)uracil? |
| A: The English name of 5-fluoro-4-(carboxymethylthio)uracil is 5-fluoro-4-(carboxymethylthio)uracil. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |