1H-Pyrido[3,4-b]indole-1-carboxylicacid, 2,3,4,9-tetrahydro-1-methyl- structure
|
Common Name | 1H-Pyrido[3,4-b]indole-1-carboxylicacid, 2,3,4,9-tetrahydro-1-methyl- | ||
|---|---|---|---|---|
| CAS Number | 6543-83-5 | Molecular Weight | 230.26200 | |
| Density | 1.312g/cm3 | Boiling Point | 474ºC at 760 mmHg | |
| Molecular Formula | C13H14N2O2 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 240.5ºC | |
| Name | 1-Methyl-2,3,4,9-tetrahydro-1H-beta-carboline-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.312g/cm3 |
|---|---|
| Boiling Point | 474ºC at 760 mmHg |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.26200 |
| Flash Point | 240.5ºC |
| Exact Mass | 230.10600 |
| PSA | 65.12000 |
| LogP | 1.94220 |
| Index of Refraction | 1.66 |
| InChIKey | CNUNWGNKMNLSTM-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)O)NCCc2c1[nH]c1ccccc21 |
| HS Code | 2933990090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-methyl-2,3,4,9-tetrahydropyrido[3,4-b]indole-1-carboxylic acid |