4-[4-(diethylamino)phenyl]but-3-en-2-one structure
|
Common Name | 4-[4-(diethylamino)phenyl]but-3-en-2-one | ||
|---|---|---|---|---|
| CAS Number | 65443-86-9 | Molecular Weight | 217.30700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H19NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[4-(diethylamino)phenyl]but-3-en-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H19NO |
|---|---|
| Molecular Weight | 217.30700 |
| Exact Mass | 217.14700 |
| PSA | 20.31000 |
| LogP | 3.13500 |
| InChIKey | FRDAMYNRZNVOAO-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1ccc(C=CC(C)=O)cc1 |
|
~87%
4-[4-(diethylam... CAS#:65443-86-9 |
| Literature: Kamakshi; Latha, S. Swarna; Reddy Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2010 , vol. 49, # 7 p. 944 - 947 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-dimethylaminobenzalacetone |
| 4-(4-Diaethylamino-phenyl)-but-3-en-2-on |
| 3-Buten-2-one,4-[4-(diethylamino)phenyl] |
| 4-Diaethylamino-benzalaceton |
| 4-(4-diethylamino-phenyl)-but-3-en-2-one |