N-(4-chlorophenyl)-2-(diethylamino)acetamide
N-(4-chlorophenyl)-2-(diethylamino)acetamide structure
|
Common Name | N-(4-chlorophenyl)-2-(diethylamino)acetamide | ||
|---|---|---|---|---|
| CAS Number | 65446-95-9 | Molecular Weight | 240.72900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H17ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(4-chlorophenyl)-2-(diethylamino)acetamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H17ClN2O |
|---|---|
| Molecular Weight | 240.72900 |
| Exact Mass | 240.10300 |
| PSA | 32.34000 |
| LogP | 2.69330 |
| InChIKey | ALKRNDPVOCXWEK-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC(=O)Nc1ccc(Cl)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
N-(4-chlorophen... CAS#:65446-95-9 |
| Literature: Beke et al. Acta Chimica Academiae Scientiarum Hungaricae, 1955 , vol. 5, p. 143,145 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-(4-chlorophenyl)-N2,N2-diethylglycinamide |
| N,N-diethyl-glycine-(4-chloro-anilide) |
| N,N-Diaethyl-glycin-(4-chlor-anilid) |
| acetamide,n-(4-chlorophenyl)-2-(diethylamino) |
| N.N-Diaethylamino-essigsaeure-(4-chlor-anilid) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of N-(4-chlorophenyl)-2-(diethylamino)acetamide? |
| A: SMILES notation of N-(4-chlorophenyl)-2-(diethylamino)acetamide is CCN(CC)CC(=O)Nc1ccc(Cl)cc1. |
| Q: What are the upstream materials of N-(4-chlorophenyl)-2-(diethylamino)acetamide? |
| A: Related upstream materials(CAS) of N-(4-chlorophenyl)-2-(diethylamino)acetamide: 109-89-7;3289-75-6. |
| Q: What is the polar surface area (PSA) of N-(4-chlorophenyl)-2-(diethylamino)acetamide? |
| A: Polar surface area (PSA) of N-(4-chlorophenyl)-2-(diethylamino)acetamide is 32.34000. |
| Q: What is the molecular weight of N-(4-chlorophenyl)-2-(diethylamino)acetamide? |
| A: Molecular weight of N-(4-chlorophenyl)-2-(diethylamino)acetamide is 240.72900. |
| Q: What is the English name of N-(4-chlorophenyl)-2-(diethylamino)acetamide? |
| A: The English name of N-(4-chlorophenyl)-2-(diethylamino)acetamide is N-(4-chlorophenyl)-2-(diethylamino)acetamide. |
| Q: What is the CAS number of N-(4-chlorophenyl)-2-(diethylamino)acetamide? |
| A: CAS number of N-(4-chlorophenyl)-2-(diethylamino)acetamide is 65446-95-9. |
| Q: What is the LogP of N-(4-chlorophenyl)-2-(diethylamino)acetamide? |
| A: LogP of N-(4-chlorophenyl)-2-(diethylamino)acetamide is 2.69330. |
| Q: What is the InChIKey of N-(4-chlorophenyl)-2-(diethylamino)acetamide? |
| A: InChIKey of N-(4-chlorophenyl)-2-(diethylamino)acetamide is ALKRNDPVOCXWEK-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 65446-95-9? |
| A: Chinese name of 65446-95-9 is 65446-95-9. |
| Q: What English synonyms does N-(4-chlorophenyl)-2-(diethylamino)acetamide have? |
| A: English synonyms of N-(4-chlorophenyl)-2-(diethylamino)acetamide: N-(4-chlorophenyl)-N2,N2-diethylglycinamide, N,N-diethyl-glycine-(4-chloro-anilide), N,N-Diaethyl-glycin-(4-chlor-anilid), acetamide,n-(4-chlorophenyl)-2-(diethylamino), N.N-Diaethylamino-essigsaeure-(4-chlor-anilid). |