2,4-Dinitro-1-(trifluoromethoxy)benzene
2,4-Dinitro-1-(trifluoromethoxy)benzene structure
|
Common Name | 2,4-Dinitro-1-(trifluoromethoxy)benzene | ||
|---|---|---|---|---|
| CAS Number | 655-07-2 | Molecular Weight | 252.10400 | |
| Density | 1.623 g/mL at 25 °C(lit.) | Boiling Point | 273-274 °C(lit.) | |
| Molecular Formula | C7H3F3N2O5 | Melting Point | -21°C | |
| MSDS | Chinese | Flash Point | >230 °F | |
| Symbol |
GHS05, GHS06 |
Signal Word | Danger | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,4-Dinitro-1-(trifluoromethoxy)benzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.623 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 273-274 °C(lit.) |
| Melting Point | -21°C |
| Molecular Formula | C7H3F3N2O5 |
| Molecular Weight | 252.10400 |
| Flash Point | >230 °F |
| Exact Mass | 251.99900 |
| PSA | 100.87000 |
| LogP | 3.44800 |
| Index of Refraction | n20/D 1.500(lit.) |
| InChIKey | KYUUZCUXYXNPFO-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(OC(F)(F)F)c([N+](=O)[O-])c1 |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Symbol |
GHS05, GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H300-H314-H413 |
| Precautionary Statements | P264-P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | T:Toxic; |
| Risk Phrases | R25;R36/37/38 |
| Safety Phrases | S26-S28-S36/37/39-S45 |
| RIDADR | UN 2927 6.1/PG 2 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 2909309090 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 3 | |
CAS#:350-50-5
CAS#:70-34-8
CAS#:873055-90-4This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,4-DIBENZYLOXYPYRIMIDINE |
| 2,4-dinitro-1-trifluoromethoxy-benzene |
| 2,4-Dinitro-1-trifluormethoxy-benzol |
| 2,4-dinitro trifluoroanisole |
| MFCD00042268 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2,4-Dinitro-1-(trifluoromethoxy)benzene? |
| A: SMILES notation of 2,4-Dinitro-1-(trifluoromethoxy)benzene is O=[N+]([O-])c1ccc(OC(F)(F)F)c([N+](=O)[O-])c1. |
| Q: What English synonyms does 2,4-Dinitro-1-(trifluoromethoxy)benzene have? |
| A: English synonyms of 2,4-Dinitro-1-(trifluoromethoxy)benzene: 2,4-DIBENZYLOXYPYRIMIDINE, 2,4-dinitro-1-trifluoromethoxy-benzene, 2,4-Dinitro-1-trifluormethoxy-benzol, 2,4-dinitro trifluoroanisole, MFCD00042268. |
| Q: What is the molecular weight of 2,4-Dinitro-1-(trifluoromethoxy)benzene? |
| A: Molecular weight of 2,4-Dinitro-1-(trifluoromethoxy)benzene is 252.10400. |
| Q: What is the polar surface area (PSA) of 2,4-Dinitro-1-(trifluoromethoxy)benzene? |
| A: Polar surface area (PSA) of 2,4-Dinitro-1-(trifluoromethoxy)benzene is 100.87000. |
| Q: What is the English name of 2,4-Dinitro-1-(trifluoromethoxy)benzene? |
| A: The English name of 2,4-Dinitro-1-(trifluoromethoxy)benzene is 2,4-Dinitro-1-(trifluoromethoxy)benzene. |
| Q: What is the melting point of 2,4-Dinitro-1-(trifluoromethoxy)benzene? |
| A: Melting point of 2,4-Dinitro-1-(trifluoromethoxy)benzene is -21°C. |
| Q: What are the downstream products of 2,4-Dinitro-1-(trifluoromethoxy)benzene? |
| A: Related downstream products(CAS) of 2,4-Dinitro-1-(trifluoromethoxy)benzene: 350-50-5;70-34-8;873055-90-4. |
| Q: What is the InChIKey of 2,4-Dinitro-1-(trifluoromethoxy)benzene? |
| A: InChIKey of 2,4-Dinitro-1-(trifluoromethoxy)benzene is KYUUZCUXYXNPFO-UHFFFAOYSA-N. |
| Q: What is the LogP of 2,4-Dinitro-1-(trifluoromethoxy)benzene? |
| A: LogP of 2,4-Dinitro-1-(trifluoromethoxy)benzene is 3.44800. |
| Q: What is the boiling point of 2,4-Dinitro-1-(trifluoromethoxy)benzene? |
| A: Boiling point of 2,4-Dinitro-1-(trifluoromethoxy)benzene is 273-274 °C(lit.). |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |