2,4-Dinitro-1-(trifluoromethoxy)benzene structure
|
Common Name | 2,4-Dinitro-1-(trifluoromethoxy)benzene | ||
|---|---|---|---|---|
| CAS Number | 655-07-2 | Molecular Weight | 252.10400 | |
| Density | 1.623 g/mL at 25 °C(lit.) | Boiling Point | 273-274 °C(lit.) | |
| Molecular Formula | C7H3F3N2O5 | Melting Point | -21°C | |
| MSDS | Chinese | Flash Point | >230 °F | |
| Symbol |
GHS05, GHS06 |
Signal Word | Danger | |
| Name | 2,4-Dinitro-1-(trifluoromethoxy)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.623 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 273-274 °C(lit.) |
| Melting Point | -21°C |
| Molecular Formula | C7H3F3N2O5 |
| Molecular Weight | 252.10400 |
| Flash Point | >230 °F |
| Exact Mass | 251.99900 |
| PSA | 100.87000 |
| LogP | 3.44800 |
| Index of Refraction | n20/D 1.500(lit.) |
| InChIKey | KYUUZCUXYXNPFO-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(OC(F)(F)F)c([N+](=O)[O-])c1 |
| Symbol |
GHS05, GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H300-H314-H413 |
| Precautionary Statements | P264-P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | T:Toxic; |
| Risk Phrases | R25;R36/37/38 |
| Safety Phrases | S26-S28-S36/37/39-S45 |
| RIDADR | UN 2927 6.1/PG 2 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 2909309090 |
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2,4-DIBENZYLOXYPYRIMIDINE |
| 2,4-dinitro-1-trifluoromethoxy-benzene |
| 2,4-Dinitro-1-trifluormethoxy-benzol |
| 2,4-dinitro trifluoroanisole |
| MFCD00042268 |