2',3,4,4',5-Pentachlorobiphenyl structure
|
Common Name | 2',3,4,4',5-Pentachlorobiphenyl | ||
|---|---|---|---|---|
| CAS Number | 65510-44-3 | Molecular Weight | 326.43300 | |
| Density | 1.522 g/cm3 | Boiling Point | 390.2ºC at 760 mmHg | |
| Molecular Formula | C12H5Cl5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.1ºC | |
| Name | 2',3,4,4',5-Pentachlorobiphenyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.522 g/cm3 |
|---|---|
| Boiling Point | 390.2ºC at 760 mmHg |
| Molecular Formula | C12H5Cl5 |
| Molecular Weight | 326.43300 |
| Flash Point | 192.1ºC |
| Exact Mass | 323.88300 |
| LogP | 6.62060 |
| Index of Refraction | 1.619 |
| InChIKey | YAHNWSSFXMVPOU-UHFFFAOYSA-N |
| SMILES | Clc1ccc(-c2cc(Cl)c(Cl)c(Cl)c2)c(Cl)c1 |
| Storage condition | room temp |
|
~%
2',3,4,4',5-Pen... CAS#:65510-44-3 |
| Literature: Chemosphere, , vol. 31, # 2 p. 2687 - 2705 |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,2,3-trichloro-5-(2,4-dichlorophenyl)benzene |