2-Propen-1-one,1-[1,1'-biphenyl]-4-yl-3-(4-methoxyphenyl)- structure
|
Common Name | 2-Propen-1-one,1-[1,1'-biphenyl]-4-yl-3-(4-methoxyphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 6552-64-3 | Molecular Weight | 314.37700 | |
| Density | 1.126g/cm3 | Boiling Point | 509ºC at 760 mmHg | |
| Molecular Formula | C22H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.4ºC | |
| Name | (Z)-3-(4-methoxyphenyl)-1-(4-phenylphenyl)prop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.126g/cm3 |
|---|---|
| Boiling Point | 509ºC at 760 mmHg |
| Molecular Formula | C22H18O2 |
| Molecular Weight | 314.37700 |
| Flash Point | 224.4ºC |
| Exact Mass | 314.13100 |
| PSA | 26.30000 |
| LogP | 5.25830 |
| Index of Refraction | 1.622 |
| InChIKey | MNESAXRIWTZNSF-SXGWCWSVSA-N |
| SMILES | COc1ccc(C=CC(=O)c2ccc(-c3ccccc3)cc2)cc1 |
| HS Code | 2914509090 |
|---|
|
~64%
2-Propen-1-one,... CAS#:6552-64-3 |
| Literature: Applequist, Douglas E.; Gdanski, Rick D. Journal of Organic Chemistry, 1981 , vol. 46, # 12 p. 2502 - 2510 |
|
~%
2-Propen-1-one,... CAS#:6552-64-3 |
| Literature: Balasankar; Gopalakrishnan; Nagarajan European Journal of Medicinal Chemistry, 2005 , vol. 40, # 7 p. 728 - 731 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4-Methoxy-4'-phenyl-chalkon |
| 4-Anisalacetyl-diphenyl |
| 4-methoxy-4'-phenyl-chalcone |