N-Boc-4-nitro-L-phenylalanine Methyl Ester structure
|
Common Name | N-Boc-4-nitro-L-phenylalanine Methyl Ester | ||
|---|---|---|---|---|
| CAS Number | 65615-89-6 | Molecular Weight | 324.32900 | |
| Density | 1.22g/cm3 | Boiling Point | 471.136ºC at 760 mmHg | |
| Molecular Formula | C15H20N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238.735ºC | |
| Name | N-Boc-4-nitro-L-phenylalanine Methyl Ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 471.136ºC at 760 mmHg |
| Molecular Formula | C15H20N2O6 |
| Molecular Weight | 324.32900 |
| Flash Point | 238.735ºC |
| Exact Mass | 324.13200 |
| PSA | 110.45000 |
| LogP | 3.11770 |
| Index of Refraction | 1.528 |
| InChIKey | OIPSJKHEYTWZBQ-LBPRGKRZSA-N |
| SMILES | COC(=O)C(Cc1ccc([N+](=O)[O-])cc1)NC(=O)OC(C)(C)C |
| Storage condition | -20°C |
| HS Code | 2924299090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 2 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (S)-3-[4-nitrophenyl]-2-tert-butoxycarbonylamino-propionic acid methyl ester |
| (S)-2-tert-butoxycarbonylamino-3-(4-nitro-phenyl)-propionic acid methyl ester |
| Methyl (2S)-2-[(tert-butoxycarbonyl)amino]-3-(4-nitrophenyl)propanoate |
| N-tert-Butoxycarbonyl-4-nitro-L-phenylalanine methyl ester |
| N-[(1,1-dimethylethoxy)carbonyl]-4-nitro-L-phenylalanine methyl ester |
| 4-nitro-N-[(1,1-dimethylethoxy)carbonyl]-L-phenylalanine methyl ester |