4-Nitro-3-phenyl-L-alanine structure
|
Common Name | 4-Nitro-3-phenyl-L-alanine | ||
|---|---|---|---|---|
| CAS Number | 949-99-5 | Molecular Weight | 210.187 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 414.1±35.0 °C at 760 mmHg | |
| Molecular Formula | C9H10N2O4 | Melting Point | 222-223ºC | |
| MSDS | N/A | Flash Point | 204.2±25.9 °C | |
| Name | (2S)-2-amino-3-(4-nitrophenyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 414.1±35.0 °C at 760 mmHg |
| Melting Point | 222-223ºC |
| Molecular Formula | C9H10N2O4 |
| Molecular Weight | 210.187 |
| Flash Point | 204.2±25.9 °C |
| Exact Mass | 210.064056 |
| PSA | 109.14000 |
| LogP | 0.84 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.614 |
| InChIKey | GTVVZTAFGPQSPC-QMMMGPOBSA-N |
| SMILES | NC(Cc1ccc([N+](=O)[O-])cc1)C(=O)O |
| Storage condition | Store at RT. |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Hazard Codes | Xn:Harmful; |
|---|---|
| Risk Phrases | R22;R36/37/38 |
| Safety Phrases | S22-S26-S36/37/39 |
| RIDADR | UN 2811 |
| RTECS | AY7400000 |
| HS Code | 2922499990 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
|
Name: Dicer-mediated maturation of pre-microRNA
Source: Center for Chemical Genomics, University of Michigan
Target: N/A
External Id: TargetID_659_CEMA
|
|
Name: Inhibitors of CDC25B-CDK2/CyclinA interaction
Source: Center for Chemical Genomics, University of Michigan
External Id: MScreen:TargetID_600
|
| 4-nitro-DL-phenylalanine |
| L-4-Nitrophe |
| L-4-Nitrophenylalanine |
| L-Phenylalanine,4-nitro |
| 4-Nitrophenylalanine |
| L-Phenylalanine, 4-nitro- (9CI) |
| p-Nitrophenylalanine |
| Nitrophenylalanine |
| Phenylalanine,4-nitro |
| 4-14-00-01677 (Beilstein Handbook Reference) |
| L-p-Nitrophenylalanine |
| p-Nitro-L-phenylalanine |
| L-Phe(4-NO2)-OH |
| 3-(4-Nitrophenyl)-L-alanine |
| 4-Nitro-3-phenyl-L-alanine |
| MFCD00051221 |
| dl-p-Nitrophenylalanine |
| EINECS 213-446-8 |
| (2S)-2-amino-3-(4-nitrophenyl)propanoic acid |