1-(3,4-DICHLOROPHENYL)-4-OXOCYCLOHEXANECARBONITRILE structure
|
Common Name | 1-(3,4-DICHLOROPHENYL)-4-OXOCYCLOHEXANECARBONITRILE | ||
|---|---|---|---|---|
| CAS Number | 65619-30-9 | Molecular Weight | 268.138 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 438.2±45.0 °C at 760 mmHg | |
| Molecular Formula | C13H11Cl2NO | Melting Point | 154-156ºC | |
| MSDS | N/A | Flash Point | 218.8±28.7 °C | |
| Name | 1-(3,4-dichlorophenyl)-4-oxocyclohexane-1-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 438.2±45.0 °C at 760 mmHg |
| Melting Point | 154-156ºC |
| Molecular Formula | C13H11Cl2NO |
| Molecular Weight | 268.138 |
| Flash Point | 218.8±28.7 °C |
| Exact Mass | 267.021759 |
| PSA | 40.86000 |
| LogP | 2.60 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.584 |
| InChIKey | YDVFTCZQEZJUIH-UHFFFAOYSA-N |
| SMILES | N#CC1(c2ccc(Cl)c(Cl)c2)CCC(=O)CC1 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R22 |
| Safety Phrases | S22-S36/37 |
| RIDADR | UN 3276 |
| HS Code | 2926909090 |
|
~57%
1-(3,4-DICHLORO... CAS#:65619-30-9 |
| Literature: Lednicer, Daniel; VonVoigtlander, Philip F.; Emmert, D. Edward Journal of Medicinal Chemistry, 1980 , vol. 23, # 4 p. 424 - 430 |
|
~0%
1-(3,4-DICHLORO... CAS#:65619-30-9 |
| Literature: Allan, Graham R.; Carnell, Andrew J.; Kroutil, Wolfgang Tetrahedron Letters, 2001 , vol. 42, # 34 p. 5959 - 5962 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1-(3,4-Dichlorophenyl)-4-oxocyclohexanecarbonitrile |