6-methoxyquinoline n-oxide
Modify Date: 2025-08-27 17:22:32
6-methoxyquinoline n-oxide structure
|
Common Name | 6-methoxyquinoline n-oxide | ||
|---|---|---|---|---|
| CAS Number | 6563-13-9 | Molecular Weight | 175.18400 | |
| Density | 1.16g/cm3 | Boiling Point | 340.1ºC at 760 mmHg | |
| Molecular Formula | C10H9NO2 | Melting Point | 102-104ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 159.5ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 6-methoxy-1-oxidoquinolin-1-ium |
|---|---|
| Synonym | More Synonyms |
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 340.1ºC at 760 mmHg |
| Melting Point | 102-104ºC(lit.) |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.18400 |
| Flash Point | 159.5ºC |
| Exact Mass | 175.06300 |
| PSA | 34.69000 |
| LogP | 2.27690 |
| Index of Refraction | 1.573 |
| InChIKey | BWEGRKPOJXNZSK-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(ccc[n+]2[O-])c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26;S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933499090 |
|
~83%
6-methoxyquinol... CAS#:6563-13-9 |
| Literature: McArthur, Silvia Gatti; Hertel, Cornelia; Nettekoven, Matthias Heinrich; Raab, Susanne; Richter, Hans; Roche, Olivier; Rodriguez-Sarmiento, Rosa Maria; Schuler, Franz Patent: US2006/84679 A1, 2006 ; Location in patent: Page/Page column 12 ; US 20060084679 A1 |
|
~%
6-methoxyquinol... CAS#:6563-13-9 |
| Literature: Okamoto Yakugaku Zasshi, 1951 , vol. 71, p. 297,299 Chem.Abstr., 1952 , p. 4542 |
| Precursor 3 | |
|---|---|
| DownStream 10 | |
CAS#:5467-79-8
CAS#:6279-51-2
CAS#:13676-02-3
CAS#:4295-04-9
CAS#:13676-00-1
CAS#:13676-01-2
CAS#:74857-01-5
CAS#:74857-16-2
CAS#:74857-07-1| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Energetics of 6-methoxyquinoline and 6-methoxyquinoline< i> N</i>-oxide: the dissociation enthalpy of the (N–O) bond. Ribeiro da Silva MD, et al.
J. Chem. Thermodyn. 35(7) , 1093-1100, (2003)
|
| AC1L5OXQ |
| 6-methoxy-quinoline-1-oxide |
| 6-methoxyquinolin-1-ol |
| MFCD00009771 |
| 6-Methoxyquinoline N-oxide |