Biphenyl-3-sulfonyl chloride structure
|
Common Name | Biphenyl-3-sulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 65685-01-0 | Molecular Weight | 252.71700 | |
| Density | 1.321g/cm3 | Boiling Point | 397.824ºC at 760 mmHg | |
| Molecular Formula | C12H9ClO2S | Melting Point | N/A | |
| MSDS | USA | Flash Point | 194.397ºC | |
| Name | 3-phenylbenzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.321g/cm3 |
|---|---|
| Boiling Point | 397.824ºC at 760 mmHg |
| Molecular Formula | C12H9ClO2S |
| Molecular Weight | 252.71700 |
| Flash Point | 194.397ºC |
| Exact Mass | 252.00100 |
| PSA | 42.52000 |
| LogP | 4.36190 |
| Index of Refraction | 1.596 |
| InChIKey | LKSVJXWZVULUDA-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)c1cccc(-c2ccccc2)c1 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Biphenyl-3-sulfonyl chloride |
| 3-phenylbenzenesulphonyl chloride |
| biphenyl-3-sufonyl chloride |
| 3-phenylbenzenesulfonylchloride |
| Biphenyl-3-sulphonyl chloride |
| 3-biphenyl-sulfonyl chloride |
| 3-phenylbenzene-1-sulfonyl chloride |
| Biphenyl-3-sulfonylchlorid |
| 3-biphenyl chloride |