(3S)-4-methoxy-4-oxo-3-[(2,2,2-trifluoroacetyl)amino]butanoate
![(3S)-4-methoxy-4-oxo-3-[(2,2,2-trifluoroacetyl)amino]butanoate Structure](https://image.chemsrc.com/caspic/146/657-19-2.png)
(3S)-4-methoxy-4-oxo-3-[(2,2,2-trifluoroacetyl)amino]butanoate structure
|
Common Name | (3S)-4-methoxy-4-oxo-3-[(2,2,2-trifluoroacetyl)amino]butanoate | ||
|---|---|---|---|---|
| CAS Number | 657-19-2 | Molecular Weight | 242.12900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H7F3NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: (3S)-4-Methoxy-4-oxo-3-[(2,2,2-trifluoroacetyl)amino]butanoate, also known as (3S)-4-甲氧基-4-羰基-3-[(2,2,2-三氟乙酰)氨基]丁酸酯, CAS number 657-19-2, molecular formula C7H7F3NO5, molecular weight 242.12900. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (3S)-4-methoxy-4-oxo-3-[(2,2,2-trifluoroacetyl)amino]butanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H7F3NO5 |
|---|---|
| Molecular Weight | 242.12900 |
| Exact Mass | 242.02800 |
| PSA | 99.02000 |
| InChIKey | OUDCCNCAFDBFQO-VKHMYHEASA-M |
| SMILES | COC(=O)C(CC(=O)[O-])NC(=O)C(F)(F)F |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:2185-03-7This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 657-19-2? |
| A: Chinese name of 657-19-2 is 657-19-2. |
| Q: What is the SMILES notation of (3S)-4-methoxy-4-oxo-3-[(2,2,2-trifluoroacetyl)amino]butanoate? |
| A: SMILES notation of (3S)-4-methoxy-4-oxo-3-[(2,2,2-trifluoroacetyl)amino]butanoate is COC(=O)C(CC(=O)[O-])NC(=O)C(F)(F)F. |
| Q: What is the CAS number of (3S)-4-methoxy-4-oxo-3-[(2,2,2-trifluoroacetyl)amino]butanoate? |
| A: CAS number of (3S)-4-methoxy-4-oxo-3-[(2,2,2-trifluoroacetyl)amino]butanoate is 657-19-2. |
| Q: What is the molecular weight of (3S)-4-methoxy-4-oxo-3-[(2,2,2-trifluoroacetyl)amino]butanoate? |
| A: Molecular weight of (3S)-4-methoxy-4-oxo-3-[(2,2,2-trifluoroacetyl)amino]butanoate is 242.12900. |
| Q: What is the molecular formula of (3S)-4-methoxy-4-oxo-3-[(2,2,2-trifluoroacetyl)amino]butanoate? |
| A: Molecular formula of (3S)-4-methoxy-4-oxo-3-[(2,2,2-trifluoroacetyl)amino]butanoate is C7H7F3NO5. |
| Q: What is the InChIKey of (3S)-4-methoxy-4-oxo-3-[(2,2,2-trifluoroacetyl)amino]butanoate? |
| A: InChIKey of (3S)-4-methoxy-4-oxo-3-[(2,2,2-trifluoroacetyl)amino]butanoate is OUDCCNCAFDBFQO-VKHMYHEASA-M. |
| Q: What are the downstream products of (3S)-4-methoxy-4-oxo-3-[(2,2,2-trifluoroacetyl)amino]butanoate? |
| A: Related downstream products(CAS) of (3S)-4-methoxy-4-oxo-3-[(2,2,2-trifluoroacetyl)amino]butanoate: 2185-03-7. |
| Q: What is the polar surface area (PSA) of (3S)-4-methoxy-4-oxo-3-[(2,2,2-trifluoroacetyl)amino]butanoate? |
| A: Polar surface area (PSA) of (3S)-4-methoxy-4-oxo-3-[(2,2,2-trifluoroacetyl)amino]butanoate is 99.02000. |
| Q: What is the English name of (3S)-4-methoxy-4-oxo-3-[(2,2,2-trifluoroacetyl)amino]butanoate? |
| A: The English name of (3S)-4-methoxy-4-oxo-3-[(2,2,2-trifluoroacetyl)amino]butanoate is (3S)-4-methoxy-4-oxo-3-[(2,2,2-trifluoroacetyl)amino]butanoate. |